CAS 174264-50-7: RALOXIFENE 6-GLUCURONIDE
Description:Raloxifene 6-glucuronide is a metabolite of raloxifene, a selective estrogen receptor modulator (SERM) primarily used in the treatment and prevention of osteoporosis in postmenopausal women. This compound is characterized by its glucuronidation, a process that enhances the solubility and excretion of drugs. Raloxifene 6-glucuronide exhibits similar pharmacological properties to its parent compound, contributing to its efficacy in modulating estrogen receptors, particularly in bone tissue. It is known for its ability to mimic estrogen's beneficial effects on bone density while minimizing risks associated with hormone replacement therapy. The compound is typically studied in the context of pharmacokinetics and metabolism, as its formation and elimination can influence the overall therapeutic outcomes of raloxifene. Additionally, its safety profile and potential interactions with other medications are important considerations in clinical settings. Overall, raloxifene 6-glucuronide plays a significant role in the pharmacological landscape of osteoporosis treatment.
Formula:C34H35NO10S
InChI:InChI=1/C34H35NO10S/c36-21-8-4-20(5-9-21)32-26(27(37)19-6-10-22(11-7-19)43-17-16-35-14-2-1-3-15-35)24-13-12-23(18-25(24)46-32)44-34-30(40)28(38)29(39)31(45-34)33(41)42/h4-13,18,28-31,34,36,38-40H,1-3,14-17H2,(H,41,42)/t28-,29-,30-,31?,34+/m0/s1
- Synonyms:
- Raloxifene-D4-6'-Glucuronide
- 2-(4-Hydroxyphenyl)-3-[4-[2-(1-piperidinyl)ethoxybenzoyl]benzo[b]thien-6-yl]-D-glucopyranosiduronicacid
- 2-(4-Hydroxyphenyl)-3-[4-[2-(1-piperidinyl)ethoxybenzoyl]benzo[b]thien-6-yl]-b-D-glucopyranosiduronic Acid
- 2-(4-Hydroxyphenyl)-3-[4-[2-(1-piperidinyl)ethoxy-d4-benzoyl]benzo[b]thien-6-yl]-b-D-glucopyranosiduronic Acid
- Ralaxifene6'-glucuronide
- (2-(4-Hydroxyphenyl)-3-[4-[2-(1-piperidinyl)ethoxy-D4-benzoyl]benzo[b]thien-6-yl]-D-glucopyranosiduronic acid)