CymitQuimica logo

CAS 17429-69-5

:

5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-4-oxo-4H-chromen-3-yl 6-O-beta-D-glucopyranosyl-beta-D-glucopyranoside

Description:
5,7-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-4-oxo-4H-chromen-3-yl 6-O-beta-D-glucopyranosyl-beta-D-glucopyranoside, with CAS number 17429-69-5, is a flavonoid glycoside characterized by its complex structure, which includes a chromone backbone and multiple hydroxyl groups. This compound exhibits significant antioxidant properties due to the presence of hydroxyl groups, which can scavenge free radicals. The glucopyranosyl moieties enhance its solubility and bioavailability, making it potentially beneficial in various biological applications. It is often studied for its potential health benefits, including anti-inflammatory and anticancer activities, attributed to its ability to modulate various biochemical pathways. The compound's structural features suggest it may interact with cellular receptors and enzymes, contributing to its pharmacological effects. Additionally, its natural occurrence in certain plants indicates its role in traditional medicine and its potential as a dietary supplement. Overall, this compound represents a fascinating area of research in phytochemistry and medicinal chemistry.
Formula:C28H32O17
InChI:InChI=1/C28H32O17/c1-40-13-4-9(2-3-11(13)31)25-26(20(35)17-12(32)5-10(30)6-14(17)42-25)45-28-24(39)22(37)19(34)16(44-28)8-41-27-23(38)21(36)18(33)15(7-29)43-27/h2-6,15-16,18-19,21-24,27-34,36-39H,7-8H2,1H3/t15-,16-,18-,19-,21+,22+,23-,24-,27-,28+/m1/s1
InChI key:GPZLFWVUSQREQH-QDYVESOYSA-N
SMILES:COC1=C(C=CC(=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)O)O)O)O
Synonyms:
  • 4H-1-Benzopyran-4-one, 3-((6-O-beta-D-glucopyranosyl-beta-D-glucopyranosyl)oxy)-5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-
Found 5 products.