CAS 17430-98-7

S(+)-1-cyclohexylethylamine

Description:

S(+)-1-cyclohexylethylamine is an organic compound characterized by its chiral amine structure, which includes a cyclohexyl group attached to an ethylamine backbone. This compound is known for its potential applications in asymmetric synthesis and as a chiral auxiliary in various chemical reactions. It typically exists as a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the cyclohexyl group contributes to its hydrophobic characteristics, while the amine functional group imparts basicity and potential for hydrogen bonding. S(+)-1-cyclohexylethylamine is often utilized in the synthesis of pharmaceuticals and agrochemicals, where its chiral nature can influence the biological activity of the resulting compounds. Additionally, it may exhibit varying solubility in polar and non-polar solvents, making it versatile for different chemical processes. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₈H₁₇N

InChI: InChI=1/C8H17N/c1-7(9)8-5-3-2-4-6-8/h7-8H,2-6,9H2,1H3/t7-/m1/s1

SMILES: C[C@H](C1CCCCC1)N

Synonyms:

• (S)-(+)-alpha-Methylcyclohexanemethylamine
• (1S)-1-cyclohexylethanamine
• (1R)-1-cyclohexylethanamine

(S)-(+)-1-Cyclohexylethylamine

CAS: 17430-98-7

Formula: C₈H₁₇N

Purity: >98.0%(GC)(T)

Color and Shape: Colorless to Almost colorless clear liquid

Molecular weight: 127.23

Ref: 3B-C1531

Cyclohexanemethanamine, α-methyl-, (αS)-

CAS: 17430-98-7

Formula: C₈H₁₇N

Purity: 98%

Color and Shape: Liquid

Molecular weight: 127.2273

Ref: IN-DA001ZKI

(S)-(+)-1-Cyclohexylethylamine

CAS: 17430-98-7

(S)-(+)-1-Cyclohexylethylamine

Purity: 98%

Molecular weight: 127.23g/mol

Ref: 54-OR1008581

(S)-1-Cyclohexylethanamine

CAS: 17430-98-7

Formula: C₈H₁₇N

Purity: 98%

Color and Shape: Liquid, Clear

Molecular weight: 127.231

Ref: 10-F436548