CAS 174303-00-5

2-Chloro-6-fluorobenzenemethanesulfonamide

Description:

2-Chloro-6-fluorobenzenemethanesulfonamide is an organic compound characterized by its sulfonamide functional group, which is a key feature in many pharmaceuticals. This compound contains a benzene ring substituted with both a chlorine atom and a fluorine atom, contributing to its unique reactivity and potential biological activity. The presence of the methanesulfonamide group enhances its solubility in polar solvents, making it suitable for various chemical reactions and applications. The chlorine and fluorine substituents can influence the compound's electronic properties, potentially affecting its interaction with biological targets. This compound may be of interest in medicinal chemistry, particularly in the development of drugs targeting specific diseases. Its CAS number, 174303-00-5, allows for precise identification in chemical databases and literature. As with many sulfonamides, it may exhibit antibacterial properties, although specific biological activities would need to be evaluated through experimental studies. Overall, 2-Chloro-6-fluorobenzenemethanesulfonamide represents a versatile structure in organic synthesis and pharmaceutical research.

Formula: C₇H₇ClFNO₂S

InChI: InChI=1S/C7H7ClFNO2S/c8-6-2-1-3-7(9)5(6)4-13(10,11)12/h1-3H,4H2,(H2,10,11,12)

InChI key: InChIKey=HZXUSJFMOMJRJX-UHFFFAOYSA-N

SMILES: C(S(N)(=O)=O)C1=C(Cl)C=CC=C1F

Synonyms:

• 2-Chloro-6-fluorobenzenemethanesulfonamide
• Benzenemethanesulfonamide, 2-chloro-6-fluoro-
• (2-Chloro-6-fluorophenyl)methanesulfonamide

(2-Chloro-6-fluorophenyl)methanesulfonamide

CAS: 174303-00-5

Versatile small molecule scaffold

Formula: C₇H₇ClFNO₂S

Purity: Min. 95%

Molecular weight: 223.65 g/mol

Ref: 3D-ZGA30300