CAS 174397-53-6
:Tetraethyl 2,2'-bipyridine-4,4'-diylbis(phosphonate)
Description:
Tetraethyl 2,2'-bipyridine-4,4'-diylbis(phosphonate) is a chemical compound characterized by its complex structure, which includes a bipyridine moiety and phosphonate groups. The bipyridine component consists of two pyridine rings connected at the 2 and 2' positions, while the phosphonate groups are ester derivatives of phosphonic acid, contributing to the compound's potential as a ligand in coordination chemistry. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents, which enhances its utility in various chemical applications, including catalysis and as a building block in organic synthesis. The presence of phosphonate groups imparts unique reactivity and stability, making it of interest in fields such as materials science and medicinal chemistry. Additionally, due to its structural features, it may exhibit interesting electronic properties and coordination behavior with metal ions, which can be explored for applications in sensors or as catalysts in chemical reactions.
Formula:C18H26N2O6P2
InChI:InChI=1/C18H26N2O6P2/c1-5-23-27(21,24-6-2)15-9-11-19-17(13-15)18-14-16(10-12-20-18)28(22,25-7-3)26-8-4/h9-14H,5-8H2,1-4H3
SMILES:CCOP(=O)(c1ccnc(c1)c1cc(ccn1)P(=O)(OCC)OCC)OCC
Synonyms:- phosphonic acid, P,P'-[2,2'-bipyridine]-4,4'-diylbis-, tetraethyl ester
- Tetraethyl 2,2'-bipyridine-4,4'-bisphosphonate
- Tetraethyl-2,2'-bipyridin-4,4'-diylbis(phosphonat)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Tetraethyl [2,2'-Bipyridine]-4,4'-diylbis(phosphonate)
CAS:Formula:C18H26N2O6P2Purity:>98.0%(T)(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:428.36Tetraethyl [2,2'-bipyridine]-4,4'-diylbis(phosphonate)
CAS:Formula:C18H26N2O6P2Purity:97%Color and Shape:SolidMolecular weight:428.3564Tetraethyl [2,2'-bipyridine]-4,4'-diylbis(phosphonate)
CAS:Tetraethyl [2,2'-bipyridine]-4,4'-diylbis(phosphonate)Purity:98%Molecular weight:428.36g/molTetraethyl 2,2'-bipyridine-4,4'-diylbisphosphonate
CAS:<p>Tetraethyl 2,2'-bipyridine-4,4'-diylbisphosphonate is a chemical that is used as an intermediate in the synthesis of other fine chemicals. Tetraethyl 2,2'-bipyridine-4,4'-diylbisphosphonate can be used as a building block for synthesis of more complex compounds with high chemical and biological activity. Tetraethyl 2,2'-bipyridine-4,4'-diylbisphosphonate can also be used to synthesize speciality chemicals or research chemicals. This compound has many versatile uses due to its ability to react with different substances to form new chemical compounds.</p>Formula:C18H26N2O6P2Purity:Min. 95%Color and Shape:PowderMolecular weight:428.36 g/mol




