CymitQuimica logo

CAS 174482-89-4

:

(4-chloro-3-nitrophenyl)(morpholin-4-yl)methanone

Description:
(4-chloro-3-nitrophenyl)(morpholin-4-yl)methanone, with the CAS number 174482-89-4, is a chemical compound characterized by its complex structure, which includes a phenyl ring substituted with both a chlorine and a nitro group, as well as a morpholine moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to the presence of the nitro and morpholine groups. The chlorine atom introduces electronegativity, which can influence the compound's reactivity and solubility in various solvents. The morpholine ring contributes to the compound's overall polarity and can affect its interaction with biological targets. Such compounds are often studied for their potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. Additionally, the presence of functional groups like the nitro and carbonyl can facilitate further chemical modifications, making it a versatile intermediate in organic synthesis.
Formula:C11H11ClN2O4
InChI:InChI=1/C11H11ClN2O4/c12-9-2-1-8(7-10(9)14(16)17)11(15)13-3-5-18-6-4-13/h1-2,7H,3-6H2
SMILES:c1cc(c(cc1C(=O)N1CCOCC1)N(=O)=O)Cl
Synonyms:
  • (4-Chloro-3-nitro-phenyl)-morpholin-4-yl-methanone
  • Methanone, (4-Chloro-3-Nitrophenyl)-4-Morpholinyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.