CAS 174485-72-4
:5-(Trifluoromethyl)-2-pyridinesulfonyl chloride
Description:
5-(Trifluoromethyl)-2-pyridinesulfonyl chloride is a chemical compound characterized by its sulfonyl chloride functional group attached to a pyridine ring, which is further substituted with a trifluoromethyl group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its reactivity, particularly due to the presence of the sulfonyl chloride group, which can participate in nucleophilic substitution reactions. The trifluoromethyl group enhances the compound's lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry and agrochemical applications. Additionally, this compound is sensitive to moisture and should be handled with care, as it can release hydrochloric acid upon hydrolysis. Proper storage in a cool, dry place and the use of appropriate personal protective equipment are essential when working with this substance. Overall, its unique structural features contribute to its utility in various chemical syntheses and applications.
Formula:C6H3ClF3NO2S
InChI:InChI=1S/C6H3ClF3NO2S/c7-14(12,13)5-2-1-4(3-11-5)6(8,9)10/h1-3H
InChI key:InChIKey=MRIFFPWOMKLYKZ-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=CC(S(Cl)(=O)=O)=NC1
Synonyms:- 2-Pyridinesulfonyl Chloride, 5-(Trifluoromethyl)-
- 5-(Trifluoromethyl)-2-pyridinesulfonyl chloride
- 5-(Trifluoromethyl)pyridine-2-sulfonyl chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Pyridinesulfonyl chloride, 5-(trifluoromethyl)-
CAS:Formula:C6H3ClF3NO2SPurity:97%Color and Shape:SolidMolecular weight:245.60675-(Trifluoromethyl)pyridine-2-sulfonyl chloride
CAS:5-(Trifluoromethyl)pyridine-2-sulfonyl chloridePurity:95%Color and Shape:SolidMolecular weight:245.61g/mol5-(Trifluoromethyl)pyridine-2-sulfonyl chloride
CAS:Formula:C6H3ClF3NO2SPurity:95%Color and Shape:SolidMolecular weight:245.65-Trifluoromethyl-2-pyridinesulfonyl Chloride, 95%, 10% in Cyclohexane
CAS:Controlled ProductFormula:C6H3ClF3NO2SColor and Shape:Single SolutionMolecular weight:245.615-Trifluoromethyl-2-pyridinesulfonyl Chloride, 95%, 10% in Benzene
CAS:Controlled ProductStability Temperature and Moisture Sensitive
Applications 5-Trifluoromethyl-2-pyridinesulfonyl Chloride, 95%, 10% in Benzene (cas# 174485-72-4) is a compound useful in organic synthesis.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the packageFormula:C6H3ClF3NO2SColor and Shape:Single SolutionMolecular weight:245.61



