CymitQuimica logo

CAS 174500-88-0

:

6-cyano-1H-indole-3-carboxylic acid

Description:
6-Cyano-1H-indole-3-carboxylic acid is an organic compound characterized by its indole structure, which features a fused bicyclic system comprising a benzene ring and a pyrrole ring. The presence of a cyano group (-CN) at the 6-position and a carboxylic acid group (-COOH) at the 3-position contributes to its chemical reactivity and potential applications. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid functionality. It is of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activities and ability to act as a building block for more complex molecules. The cyano group can participate in nucleophilic reactions, while the carboxylic acid can engage in hydrogen bonding, influencing its interactions in biological systems. Overall, 6-cyano-1H-indole-3-carboxylic acid is a versatile compound with significant implications in synthetic and pharmaceutical chemistry.
Formula:C10H6N2O2
InChI:InChI=1S/C10H6N2O2/c11-4-6-1-2-7-8(10(13)14)5-12-9(7)3-6/h1-3,5,12H,(H,13,14)
InChI key:QBYXDZPCHOTIDJ-UHFFFAOYSA-N
SMILES:C1=CC2=C(C=C1C#N)NC=C2C(=O)O
Found 4 products.