CAS 174511-17-2
:[(4S,5R)-3,4,5-triacetoxy-6-fluoro-tetrahydropyran-2-yl]methyl acetate
Description:
The chemical substance known as [(4S,5R)-3,4,5-triacetoxy-6-fluoro-tetrahydropyran-2-yl]methyl acetate, with the CAS number 174511-17-2, is a complex organic compound characterized by its tetrahydropyran ring structure, which is a six-membered cyclic ether. This compound features multiple acetoxy groups, indicating the presence of acetyl functional groups that enhance its reactivity and solubility in organic solvents. The inclusion of a fluorine atom suggests potential applications in medicinal chemistry, as fluorinated compounds often exhibit unique biological activities. The stereochemistry, denoted by the (4S,5R) configuration, indicates specific spatial arrangements of atoms that can influence the compound's interactions and properties. This substance may be of interest in the synthesis of pharmaceuticals or as an intermediate in organic synthesis due to its functional groups and structural characteristics. Its stability, solubility, and reactivity would depend on the specific conditions under which it is handled, including temperature and the presence of other reagents.
Formula:C14H19FO9
InChI:InChI=1/C14H19FO9/c1-6(16)20-5-10-11(21-7(2)17)12(22-8(3)18)13(14(15)24-10)23-9(4)19/h10-14H,5H2,1-4H3/t10?,11?,12-,13+,14?/m0/s1
Synonyms:- 2,3,4,6-Tetra-O-acetyl-D-erythro-hexopyranosyl fluoride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
D-Mannopyranosyl fluoride, 2,3,4,6-tetraacetate
CAS:Formula:C14H19FO9Purity:95.0%Color and Shape:SolidMolecular weight:350.29372,3,4,6-Tetra-O-acetyl-D-mannopyranosyl Fluoride
CAS:Formula:C14H19FO9Purity:>95.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:350.302,3,4,6-Tetra-O-acetyl-D-mannopyranosyl fluoride
CAS:2,3,4,6-Tetra-O-acetyl-D-mannopyranosyl fluoride is a methylated, fluorinated oligosaccharide. It is a custom synthesis and can be used as a monosaccharide to modify polysaccharides or saccharides. The modification of the sugar with 2,3,4,6-Tetra-O-acetyl-D-mannopyranosyl fluoride increases the water solubility of the complex carbohydrate and its ability to be synthesized into other compounds. This product is high purity and has been modified with fluorine for better stability.
Formula:C14H19FO9Purity:Min. 95%Molecular weight:350.29 g/mol


