CymitQuimica logo

CAS 174513-95-2

:

20-[[3-[(Aminocarbonyl)oxy]-2-methyl-1-oxobutyl]amino]-19-hydroxy-3,5,15-trimethyl-7-methylene-17-oxo-2,10,12-eicosatrienoic acid

Description:
The chemical substance known as 20-[[3-[(Aminocarbonyl)oxy]-2-methyl-1-oxobutyl]amino]-19-hydroxy-3,5,15-trimethyl-7-methylene-17-oxo-2,10,12-eicosatrienoic acid, with the CAS number 174513-95-2, is a complex organic compound characterized by its intricate structure, which includes multiple functional groups such as amino, hydroxyl, and carbonyl moieties. This compound is part of a larger class of molecules known as fatty acids, specifically modified eicosanoids, which are known for their roles in various biological processes. The presence of multiple methyl groups and a long carbon chain contributes to its hydrophobic characteristics, while the amino and hydroxyl groups enhance its solubility in polar solvents. The compound may exhibit biological activity, potentially influencing metabolic pathways or cellular signaling due to its structural features. Its synthesis and applications are of interest in medicinal chemistry and biochemistry, particularly in the context of drug development and therapeutic interventions. Further studies would be necessary to elucidate its specific biological functions and potential uses.
Formula:C30H48N2O7
InChI:InChI=1S/C30H48N2O7/c1-20(14-22(3)15-23(4)17-28(35)36)12-10-8-7-9-11-13-21(2)16-26(33)18-27(34)19-32-29(37)24(5)25(6)39-30(31)38/h7-9,11,17,21-22,24-25,27,34H,1,10,12-16,18-19H2,2-6H3,(H2,31,38)(H,32,37)(H,35,36)
InChI key:InChIKey=GENAAYFYLGYPIQ-UHFFFAOYSA-N
SMILES:C(NCC(CC(CC(CC=CC=CCCC(CC(CC(=CC(O)=O)C)C)=C)C)=O)O)(C(C(OC(N)=O)C)C)=O
Synonyms:
  • 20-[[3-[(Aminocarbonyl)oxy]-2-methyl-1-oxobutyl]amino]-19-hydroxy-3,5,15-trimethyl-7-methylene-17-oxo-2,10,12-eicosatrienoic acid
  • 2,10,12-Eicosatrienoic acid, 20-[[3-[(aminocarbonyl)oxy]-2-methyl-1-oxobutyl]amino]-19-hydroxy-3,5,15-trimethyl-7-methylene-17-oxo-
  • Kalimantacin A
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.