CAS 174514-07-9
:Fluazolate
Description:
Fluazolate is a chemical compound classified as a fungicide, primarily used in agricultural applications to control various fungal diseases in crops. It belongs to the class of compounds known as triazoles, which are characterized by a five-membered ring containing three nitrogen atoms. Fluazolate exhibits systemic properties, allowing it to be absorbed by plants and translocated to different parts, providing effective protection against pathogens. Its mode of action typically involves the inhibition of ergosterol biosynthesis, a crucial component of fungal cell membranes, thereby disrupting fungal growth and reproduction. The compound is known for its broad-spectrum efficacy and relatively low toxicity to non-target organisms, making it a valuable tool in integrated pest management strategies. Additionally, fluazolate is subject to regulatory assessments to ensure environmental safety and human health protection. Its stability and persistence in the environment can vary based on factors such as soil type and climatic conditions, influencing its application and effectiveness in agricultural practices.
Formula:C15H12BrClF4N2O2
InChI:InChI=1/C15H12BrClF4N2O2/c1-6(2)25-14(24)7-4-8(10(18)5-9(7)17)12-11(16)13(15(19,20)21)23(3)22-12/h4-6H,1-3H3
SMILES:CC(C)OC(=O)c1cc(c(cc1Cl)F)c1c(c(C(F)(F)F)n(C)n1)Br
Synonyms:- 5-[4-Bromo-1-methyl-5-(trifluoromethyl)-1H-pyrazol-3-yl]-2-chloro-4-fluoro- benzoic Acid 1-Methylethyl Ester
- Isopropazol
- Isopropyl 5-[4-bromo-1-methyl-5-(trifluoromethyl)-1H-pyrazol-3-yl]-2-chloro-4-fluorobenzoate
- Jv 485
- Mon 48500
- Twin-Agro
- 1-methylethyl 5-[4-bromo-1-methyl-5-(trifluoromethyl)-1H-pyrazol-3-yl]-2-chloro-4-fluorobenzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
Fluazolate
CAS:Fluazolate is a herbicide for pre-emergence control of broad-leaved weeds and grasses.Formula:C15H12BrClF4N2O2Color and Shape:SolidMolecular weight:443.62Fluazolate 100 µg/mL in Acetonitrile
CAS:Formula:C15H12BrClF4N2O2Color and Shape:Single SolutionMolecular weight:443.62Fluazolate
CAS:Applications An active ingredient formulation to prepare agrochemicals and drugs in amorphous form.
References Blair, A.M., et al.: J. Agr. Sci., 139, 385 (2002),Formula:C15H12BrClF4N2O2Color and Shape:White To Off-WhiteMolecular weight:443.62Benzoic acid, 5-[4-bromo-1-methyl-5-(trifluoromethyl)-1H-pyrazol-3-yl]-2-chloro-4-fluoro-, 1-methylethyl ester
CAS:Formula:C15H12BrClF4N2O2Color and Shape:SolidMolecular weight:443.6186



