CAS 174518-83-3
:1-Bromo-5-iodo-2,3,4-trimethoxybenzene
Description:
1-Bromo-5-iodo-2,3,4-trimethoxybenzene is an organic compound characterized by its complex aromatic structure, which includes a benzene ring substituted with three methoxy groups, a bromine atom, and an iodine atom. The presence of multiple methoxy groups enhances its solubility in organic solvents and can influence its reactivity and interaction with biological systems. The bromine and iodine substituents introduce halogen functionalities, which can participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions. This compound may exhibit interesting electronic properties due to the electron-donating nature of the methoxy groups and the electron-withdrawing effects of the halogens. Additionally, its unique structure may confer specific biological activities, making it of interest in medicinal chemistry and material science. The compound's CAS number, 174518-83-3, allows for precise identification in chemical databases, facilitating research and application in various fields. Overall, 1-Bromo-5-iodo-2,3,4-trimethoxybenzene is a versatile compound with potential applications in synthetic chemistry and pharmaceuticals.
Formula:C9H10BrIO3
InChI:InChI=1S/C9H10BrIO3/c1-12-7-5(10)4-6(11)8(13-2)9(7)14-3/h4H,1-3H3
InChI key:InChIKey=JIOWZHSIGCLLGT-UHFFFAOYSA-N
SMILES:O(C)C1=C(OC)C(Br)=CC(I)=C1OC
Synonyms:- 1-Bromo-5-iodo-2,3,4-trimethoxybenzene
- Benzene, 1-bromo-5-iodo-2,3,4-trimethoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
