CAS 17452-12-9
:1-(4-Chlorophenyl)imidazoline-2-thione_____
Description:
1-(4-Chlorophenyl)imidazoline-2-thione, identified by its CAS number 17452-12-9, is a chemical compound that belongs to the class of imidazoline derivatives. This substance features a thione functional group, which is characterized by the presence of a sulfur atom double-bonded to a carbon atom, contributing to its reactivity and potential biological activity. The presence of the 4-chlorophenyl group indicates that the compound has a chlorinated aromatic ring, which can influence its electronic properties and interactions with biological systems. Typically, compounds of this nature may exhibit various pharmacological activities, including antimicrobial or antifungal properties, due to their structural characteristics. Additionally, the imidazoline core is known for its role in various biological processes, making such compounds of interest in medicinal chemistry. However, specific applications, toxicity, and environmental impact would require further investigation and analysis. As with any chemical substance, proper handling and safety measures should be observed when working with this compound.
Formula:C9H7ClN2S
InChI:InChI=1/C9H7ClN2S/c10-7-1-3-8(4-2-7)12-6-5-11-9(12)13/h1-6H,(H,11,13)
SMILES:c1cc(ccc1Cl)n1ccnc1S
Synonyms:- 1-(4-chlorophenyl)-1,3-dihydro-2H-imidazole-2-thione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1-(4-Chlorophenyl)-1H-imidazole-2-thiol
CAS:Formula:C9H7ClN2SColor and Shape:SolidMolecular weight:210.68331-(4-Chlorophenyl)imidazoline-2-thione
CAS:Formula:C9H7ClN2SPurity:98.0%Color and Shape:SolidMolecular weight:210.681-(4-Chlorophenyl)-1H-imidazole-2(3H)-thione
CAS:<p>1-(4-Chlorophenyl)-1H-imidazole-2(3H)-thione is a crystalline solid that belongs to the class of imidazoles. It has been synthesized by reacting 1,2-dibromoethane with sodium methoxide in methanol. The compound was found to have a melting point of about 183°C and a molecular weight of 212.06 g/mol. This compound has been shown to interact with methanol, methoxide, and ethoxy groups. Crystallization occurs when the substance is heated to about 183°C in vacuum and then cooled slowly.</p>Formula:C9H7ClN2SPurity:Min. 95%Molecular weight:210.68 g/mol


