CAS 17455-25-3
:Dibenzo-30-crown-10
Description:
Dibenzo-30-crown-10 is a member of the crown ether family, characterized by its ability to selectively bind cations due to its unique molecular structure. It features a cyclic arrangement of ether linkages and aromatic rings, which enhances its solubility in organic solvents and its ability to form complexes with various metal ions. The "30" in its name indicates that the crown ether has a total of 30 atoms in its ring structure, including both oxygen and carbon atoms. This compound is particularly effective in complexing larger cations, such as potassium and cesium, due to the size of its cavity. Its applications span across fields such as analytical chemistry, where it is used as a phase transfer catalyst, and in the development of ion-selective electrodes. Additionally, dibenzo-30-crown-10 can facilitate the extraction and separation of metal ions from solutions, making it valuable in hydrometallurgy and environmental remediation. Its properties are influenced by factors such as solvent polarity and the presence of competing ions in solution.
Formula:C28H40O10
InChI:InChI=1/C28H40O10/c1-2-6-26-25(5-1)35-21-17-31-13-9-29-11-15-33-19-23-37-27-7-3-4-8-28(27)38-24-20-34-16-12-30-10-14-32-18-22-36-26/h1-8H,9-24H2
SMILES:c1ccc2c(c1)OCCOCCOCCOCCOc1ccccc1OCCOCCOCCOCCO2
Synonyms:- Dibenzo-30-crown 10-ether
- 6,7,9,10,12,13,15,16,23,24,26,27,29,30,32,33-Hexadecahydrodibenzo[B,Q][1,4,7,10,13,16,19,22,25,28]Decaoxacyclotriacontine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Dibenzo[b,q][1,4,7,10,13,16,19,22,25,28]decaoxacyclotriacontin, 6,7,9,10,12,13,15,16,23,24,26,27,29,30,32,33-hexadecahydro-
CAS:Formula:C28H40O10Purity:97%Color and Shape:SolidMolecular weight:536.6112Dibenzo-30-crown-10-ether
CAS:Dibenzo-30-crown-10-etherFormula:C28H40O10Purity:97%Color and Shape: white solidMolecular weight:536.61119g/molDibenzo-30-crown 10-ether
CAS:Dibenzo-30-crown-10-ether is a coordination complex that contains two benzoate groups and two ether groups. It has shown to be an efficient adsorbent for the removal of lysine residues from wastewater. Dibenzo-30-crown-10-ether is also used in analytical chemistry as a standard chemical shift reference, which can be determined by its nmr spectra. It is also used as a catalyst in titration calorimetry experiments on organic solutions, such as urine samples. The hydrogen bonding interactions between the benzoate and ether groups may be important for its binding properties.
Formula:C28H40O10Purity:Min. 95%Color and Shape:White PowderMolecular weight:536.61 g/mol



