CAS 1746-11-8
:2,3-Dihydro-2-methylbenzofuran
Description:
2,3-Dihydro-2-methylbenzofuran, with the CAS number 1746-11-8, is an organic compound characterized by its bicyclic structure, which consists of a benzofuran ring system. This compound features a dihydro configuration, indicating the presence of two additional hydrogen atoms that saturate the furan ring, making it less reactive than its unsaturated counterparts. It is typically a colorless to pale yellow liquid with a distinctive aromatic odor. The compound is soluble in organic solvents and exhibits moderate stability under standard conditions. Its molecular structure contributes to its potential applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. Additionally, 2,3-dihydro-2-methylbenzofuran may exhibit biological activity, although specific pharmacological properties would require further investigation. Safety data should be consulted to understand its handling and potential hazards, as with any chemical substance.
Formula:C9H10O
InChI:InChI=1S/C9H10O/c1-7-6-8-4-2-3-5-9(8)10-7/h2-5,7H,6H2,1H3
InChI key:InChIKey=BWCJVGMZEQDOMY-UHFFFAOYSA-N
SMILES:CC1CC=2C(O1)=CC=CC2
Synonyms:- 2,3-Dihydro-2-methylbenzo[b]furan
- 2,3-Dihydro-2-methylbenzofuran
- 2-Methyl-2,3-Dihydrobenzofuran
- 2-Methyl-2,3-dihydro-1-benzo[b]furan
- 2-Methyl-2,3-dihydro-1-benzofuran
- 2-Methyl-2,3-dihydrobenzo[b]furan
- 2-Methylcoumaran
- Benzofuran, 2,3-dihydro-2-methyl-
- NSC 403556
- O-butan-2-yl O-ethyl dithiodicarbonate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Benzofuran, 2,3-dihydro-2-methyl-
CAS:Formula:C9H10OPurity:98%Color and Shape:LiquidMolecular weight:134.17512-Methyl-2,3-dihydro-1-benzofuran
CAS:2-Methyl-2,3-dihydro-1-benzofuranFormula:C9H10OPurity:98%Color and Shape: pale yellow liquidMolecular weight:134.18g/mol2,3-Dihydro-2-methylbenzofuran
CAS:Formula:C9H10OPurity:>98.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:134.182,3-Dihydro-2-methylbenzofuran
CAS:Formula:C9H10OPurity:98%Color and Shape:Liquid, ClearMolecular weight:134.1782-Methylcoumaran
CAS:Controlled ProductApplications 2-Methylcoumaran is an impurity formed during the synthesis of metabolites of Diclofenac (D436450), a nonsteroidal anti-inflammatory compound an decycloxygenase (COX) inhibitor.
Formula:C9H10OColor and Shape:NeatMolecular weight:134.182-Methylcoumaran
CAS:2-Methylcoumaran is a functionalized coumarin. It is synthesized by the reaction of 2-methylcoumarin with an alkylating agent such as acetyl chloride or benzoyl chloride. This reaction involves the substitution of one of the hydroxyl groups in 2-methylcoumarin with an alkyl group, forming a new bond between the two carbon atoms. The resulting product has two new functional groups, which can be used in organic reactions.
Formula:C9H10OPurity:Min. 95%Molecular weight:134.18 g/mol





