CAS 1746-28-7

4-BROMOPHENETHYL BROMIDE

Description:

4-Bromophenethyl bromide, with the CAS number 1746-28-7, is an organic compound characterized by its brominated aromatic structure. It features a bromine atom attached to a phenethyl group, which consists of a phenyl ring connected to a two-carbon ethyl chain. This compound is typically a colorless to pale yellow liquid and is known for its reactivity due to the presence of bromine atoms, which can participate in various nucleophilic substitution reactions. It is often used as an intermediate in organic synthesis, particularly in the preparation of pharmaceuticals and other brominated compounds. The presence of bromine enhances its electrophilic character, making it useful in coupling reactions and as a building block in the synthesis of more complex molecules. Additionally, 4-bromophenethyl bromide may exhibit moderate toxicity, necessitating careful handling and appropriate safety measures during its use in laboratory and industrial settings. Its physical and chemical properties, such as boiling point and solubility, can vary based on purity and environmental conditions.

Formula: C₈H₈Br₂

InChI: InChI=1/C8H8Br2/c9-6-5-7-1-3-8(10)4-2-7/h1-4H,5-6H2

SMILES: c1cc(ccc1CCBr)Br

Synonyms:

• 4-Bromo-1-(2-Bromoethyl)Benzene
• 1-Bromo-4-(2-Bromoethyl)Benzene
• 1-Bromo-4-(2-bromoethyl)benzene, 4-Bromo-1-(2-bromoethyl)benzene

Benzene, 1-bromo-4-(2-bromoethyl)-

CAS: 1746-28-7

Formula: C₈H₈Br₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 263.9571

Ref: IN-DA001ZT0

1-Bromo-4-(2-bromoethyl)benzene

CAS: 1746-28-7

1-Bromo-4-(2-bromoethyl)benzene

Purity: 97%

Molecular weight: 263.96g/mol

Ref: 54-OR74385

1-BROMO-4-(2-BROMOETHYL)BENZENE

CAS: 1746-28-7

Formula: C₈H₈Br₂

Purity: 96%

Color and Shape: Liquid

Molecular weight: 263.96

Ref: 10-F304695

1-Bromo-4-(2-bromoethyl)benzene

Controlled Product

CAS: 1746-28-7

Applications 1-Bromo-4-(2-bromoethyl)benzene

Formula: C₈H₈Br₂

Color and Shape: Neat

Molecular weight: 263.96

Ref: TR-B680753