CAS 174635-53-1

methyl (2R)-phenyl{[(2-phenylquinolin-4-yl)carbonyl]amino}ethanoate

Description:

Methyl (2R)-phenyl{[(2-phenylquinolin-4-yl)carbonyl]amino}ethanoate, with the CAS number 174635-53-1, is a complex organic compound characterized by its unique structural features. It contains a methyl ester functional group, which contributes to its solubility in organic solvents and potential reactivity in various chemical reactions. The presence of a quinoline moiety suggests potential biological activity, as quinolines are often associated with pharmacological properties. The compound's chirality, indicated by the (2R) configuration, implies that it may exhibit stereospecific behavior in chemical reactions and biological interactions. Additionally, the phenyl groups in its structure can enhance its stability and influence its electronic properties. Overall, this compound may be of interest in medicinal chemistry and material science due to its intricate structure and potential applications. However, specific properties such as melting point, boiling point, and solubility would require empirical data for a comprehensive understanding of its behavior in various environments.

Formula: C₂₅H₂₀N₂O₃

InChI: InChI=1/C25H20N2O3/c1-30-25(29)23(18-12-6-3-7-13-18)27-24(28)20-16-22(17-10-4-2-5-11-17)26-21-15-9-8-14-19(20)21/h2-16,23H,1H3,(H,27,28)/t23-/m1/s1

SMILES: COC(=O)[C@@H](c1ccccc1)N=C(c1cc(c2ccccc2)nc2ccccc12)O

Synonyms:

• Benzeneacetic acid, alpha-[[(2-phenyl-4-quinolinyl)carbonyl]amino]-, methyl ester, (alphaR)-
• Methyl (2R)-phenyl{[(2-phenylquinolin-4-yl)carbonyl]amino}acetate

Benzeneacetic acid, α-[[(2-phenyl-4-quinolinyl)carbonyl]amino]-, methyl ester, (αR)-

CAS: 174635-53-1

Formula: C₂₅H₂₀N₂O₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 396.4379

Ref: IN-DA001ZUB

SB 218795

CAS: 174635-53-1

SB 218795

Purity: ≥98%

Molecular weight: 396.44g/mol

Ref: 54-BUP08297

SB 218795

Controlled Product

CAS: 174635-53-1

Formula: C₂₅H₂₀N₂O₃

Color and Shape: Neat

Molecular weight: 396.438

Ref: TR-S155070

SB 218795

CAS: 174635-53-1

SB 218795 is an effective and selective antagonist of NK3 with a Ki 13 nM for hNK3 which is about 90-fold and 7000-fold selectivity over hNK2 and hNK1.

Formula: C₂₅H₂₀N₂O₃

Purity: 99.70%

Color and Shape: Solid

Molecular weight: 396.44

Ref: TM-T23316