CAS 174636-94-3

(1R)-N2,N2-Dimethyl-1-phenyl-1,2-ethanediamine

Description:

(1R)-N2,N2-Dimethyl-1-phenyl-1,2-ethanediamine, with the CAS number 174636-94-3, is an organic compound characterized by its amine functional groups and a chiral center, which contributes to its stereochemistry. This compound features two methyl groups attached to the nitrogen atoms and a phenyl group linked to the carbon backbone, which enhances its potential for interactions in biological systems. It is typically a colorless to pale yellow liquid or solid, depending on the specific conditions and purity. The presence of the amine groups suggests that it can participate in hydrogen bonding, influencing its solubility in polar solvents. Additionally, its chirality may impart unique pharmacological properties, making it of interest in medicinal chemistry. The compound's reactivity can be attributed to the amine functionalities, allowing it to engage in various chemical reactions, such as alkylation or acylation. Overall, (1R)-N2,N2-Dimethyl-1-phenyl-1,2-ethanediamine is notable for its structural features and potential applications in chemical synthesis and pharmaceuticals.

Formula: C₁₀H₁₆N₂

InChI: InChI=1S/C10H16N2/c1-12(2)8-10(11)9-6-4-3-5-7-9/h3-7,10H,8,11H2,1-2H3/t10-/m0/s1

InChI key: InChIKey=NPGAXSHDDOESHB-JTQLQIEISA-N

SMILES: [C@@H](CN(C)C)(N)C1=CC=CC=C1

Synonyms:

• (1R)-N2,N2-Dimethyl-1-phenyl-1,2-ethanediamine
• (R)-2-Dimethylamino-1-phenylethylamine
• 1,2-Ethanediamine, N2,N2-dimethyl-1-phenyl-, (R)-
• 1,2-Ethanediamine N2,N2-dimethyl-1-phenyl-, (1R)-
• 1,2-Ethanediamine, N2,N2-dimethyl-1-phenyl-, (1R)-

[(2R)-2-Amino-2-phenylethyl]dimethylamine

CAS: 174636-94-3

Versatile small molecule scaffold

Formula: C₁₀H₁₆N₂

Purity: Min. 95%

Molecular weight: 164.25 g/mol

Ref: 3D-ZGA63694