CAS 174669-73-9
:2-Fluoropyridine-3-boronic acid
Description:
2-Fluoropyridine-3-boronic acid is an organoboron compound characterized by the presence of both a boronic acid functional group and a fluorinated pyridine ring. Its molecular structure features a pyridine ring substituted at the 2-position with a fluorine atom and at the 3-position with a boronic acid group, which is known for its ability to form reversible covalent bonds with diols. This compound is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, making it useful in various chemical reactions, particularly in Suzuki coupling reactions for the synthesis of biaryl compounds. The presence of the fluorine atom can influence the electronic properties of the molecule, potentially enhancing its reactivity and selectivity in organic synthesis. Additionally, boronic acids are valuable in medicinal chemistry and materials science due to their ability to participate in cross-coupling reactions and their role in the development of boron-containing pharmaceuticals. Safety precautions should be observed when handling this compound, as with all chemical substances.
Formula:C5H5BFNO2
InChI:InChI=1/C5H5BFNO2/c7-5-4(6(9)10)2-1-3-8-5/h1-3,9-10H
SMILES:c1cc(c(F)nc1)B(O)O
Synonyms:- 2-Fluoro-3-pyridylboronic acid
- Boronic acid, B-(2-fluoro-3-pyridinyl)-
- (2-Fluoropyridin-3-Yl)Boronic Acid Hydrate
- (2-Fluoropyridin-3-Yl)Boronic Acid
- 2-Fluoro-3-Pyridineboronic Acid
- 2-Fluoropyridin-3-Ylboronic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2-Fluoropyridine-3-boronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C5H5BFNO2Purity:98.0 to 115.0 %Color and Shape:White to Light yellow powder to crystalMolecular weight:140.912-Fluoropyridine-3-boronic acid, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C5H5BFNO2Purity:97%Color and Shape:Crystals or powder or crystalline powder, White to creamMolecular weight:140.91Boronic acid, B-(2-fluoro-3-pyridinyl)-
CAS:Formula:C5H5BFNO2Purity:95%Color and Shape:SolidMolecular weight:140.90812-Fluoropyridine-3-boronic acid
CAS:2-Fluoropyridine-3-boronic acidFormula:C5H5BFNO2Purity:98%Color and Shape: off-white solidMolecular weight:140.9081g/mol2-Fluoropyridine-3-boronic acid
CAS:Formula:C5H5BFNO2Purity:95%Color and Shape:Solid, Chunks or Crystalline PowderMolecular weight:140.912-Fluoro-3-pyridineboronic acid
CAS:<p>2-Fluoro-3-pyridineboronic acid is an amide that can be used as a catalyst for transfer reactions. It forms a complex with copper chloride and isohexane, which is then heated to produce the desired product. 2-Fluoro-3-pyridineboronic acid has been used in analytical methods such as constant pressure and methyl ethyl method. This compound also has high resistance to water vapor, hexane, and organic solvents. 2-Fluoro-3-pyridineboronic acid has been shown to inhibit the MCL-1 protein, which plays a role in regulating apoptosis. It can be used as a potential therapeutic agent against infectious diseases such as tuberculosis and HIV/AIDS due to its ability to inhibit MCL-1 protein expression.</p>Formula:C5H5NO2BFPurity:Min. 95%Color and Shape:White PowderMolecular weight:140.91 g/mol






