CymitQuimica logo

CAS 1747-56-4

:

1,3,5-Triethoxy-1,3,5-trimethyl-1,3,5-trisilacyclohexane

Description:
1,3,5-Triethoxy-1,3,5-trimethyl-1,3,5-trisilacyclohexane, with CAS number 1747-56-4, is a silacyclohexane derivative characterized by the presence of three ethoxy groups and three methyl groups attached to a cyclic siloxane framework. This compound exhibits a unique structure that incorporates silicon atoms within a cyclic arrangement, contributing to its distinctive chemical properties. The presence of ethoxy groups enhances its solubility in organic solvents and may influence its reactivity, making it useful in various chemical applications, including as a precursor in the synthesis of siloxane polymers or as a potential additive in materials science. The methyl groups provide steric hindrance, which can affect the compound's stability and reactivity. Additionally, the trisilacyclohexane structure may impart interesting electronic properties, making it a subject of interest in organosilicon chemistry. Overall, this compound's unique combination of functional groups and silicon atoms positions it as a versatile building block in synthetic chemistry and materials development.
Formula:C12H30O3Si3
InChI:InChI=1S/C12H30O3Si3/c1-7-13-16(4)10-17(5,14-8-2)12-18(6,11-16)15-9-3/h7-12H2,1-6H3
InChI key:InChIKey=MQEFJQBNYDQNSM-UHFFFAOYSA-N
SMILES:O(CC)[Si]1(C)C[Si](OCC)(C)C[Si](OCC)(C)C1
Synonyms:
  • 1,3,5-Trisilacyclohexane, 1,3,5-triethoxy-1,3,5-trimethyl-
  • 1,3,5-Triethoxy-1,3,5-trimethyl-1,3,5-trisilacyclohexane
  • 1,3,5-Triethoxy-1,3,5-trimethyl-1,3,5-trisilinane
  • 1,3,5-Trimethyl-1,3,5-triethoxy-1,3,5-trisilacyclohexane
Found 1 products.