CAS 1747-92-8

tribenzylsilane

Description:

Tribenzylsilane, with the CAS number 1747-92-8, is an organosilicon compound characterized by its structure, which features a silicon atom bonded to three benzyl groups and one hydrogen atom. This compound is typically a colorless to pale yellow liquid with a relatively low viscosity. It is known for its stability and low reactivity under standard conditions, making it useful in various chemical applications. Tribenzylsilane can serve as a protecting group in organic synthesis, particularly in the field of organosilicon chemistry. Its hydrophobic nature and ability to form stable complexes with metal catalysts enhance its utility in catalysis and materials science. Additionally, tribenzylsilane can participate in hydrosilylation reactions, where it can react with alkenes or alkynes in the presence of catalysts. Safety considerations include handling it in well-ventilated areas and using appropriate personal protective equipment, as it may cause irritation upon contact with skin or eyes. Overall, tribenzylsilane is a versatile compound with significant applications in synthetic organic chemistry and materials development.

Formula: C₂₁H₂₁Si

InChI: InChI=1/C21H21Si/c1-4-10-19(11-5-1)16-22(17-20-12-6-2-7-13-20)18-21-14-8-3-9-15-21/h1-15H,16-18H2

SMILES: c1ccc(cc1)C[Si](Cc1ccccc1)Cc1ccccc1

Synonyms:

• Tribenzylsilyl

Tribenzylsilane

CAS: 1747-92-8

Formula: C₂₁H₂₂Si

Purity: >98.0%(GC)

Color and Shape: White to Light yellow powder to crystal

Molecular weight: 302.49

Ref: 3B-T1916

Benzene, 1,1',1''-[silylidynetris(methylene)]tris-

CAS: 1747-92-8

Formula: C₂₁H₂₂Si

Purity: 98%

Color and Shape: Solid

Molecular weight: 302.4849

Ref: IN-DA001ZW9

Tribenzylsilane

CAS: 1747-92-8

Tribenzylsilane

Purity: 95%

Molecular weight: 302.48g/mol

Ref: 54-OR95800

Tribenzyl silane

CAS: 1747-92-8

S16745 - Tribenzyl silane

Formula: C₂₁H₂₂Si

Purity: 98%

Color and Shape: Solid

Molecular weight: 302.492

Ref: 10-S16745