CAS 174744-18-4
:alpha-Trifluoromethyl-beta-butyrolactone
Description:
Alpha-Trifluoromethyl-beta-butyrolactone, identified by its CAS number 174744-18-4, is a chemical compound characterized by the presence of a trifluoromethyl group and a butyrolactone structure. This compound typically exhibits a polar nature due to the electronegative fluorine atoms, which can influence its reactivity and solubility in various solvents. The trifluoromethyl group is known to enhance the lipophilicity and stability of the molecule, making it of interest in synthetic organic chemistry and pharmaceuticals. As a lactone, it possesses a cyclic ester structure, which can participate in various chemical reactions, including nucleophilic attacks and polymerization processes. The compound's unique properties may also allow it to serve as an intermediate in the synthesis of more complex molecules. However, specific handling precautions should be observed due to the potential toxicity associated with fluorinated compounds. Overall, alpha-Trifluoromethyl-beta-butyrolactone represents a valuable building block in chemical synthesis, particularly in the development of fluorinated organic compounds.
Formula:C5H5F3O2
InChI:InChI=1/C5H5F3O2/c6-5(7,8)3-1-2-10-4(3)9/h3H,1-2H2/t3-/m0/s1
SMILES:C1COC(=O)[C@H]1C(F)(F)F
Synonyms:- (3R)-3-(trifluoromethyl)dihydrofuran-2(3H)-one
- (3S)-3-(trifluoromethyl)dihydrofuran-2(3H)-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3-(Trifluoromethyl)dihydrofuran-2(3H)-one
CAS:3-(Trifluoromethyl)dihydrofuran-2(3H)-oneFormula:C5H5F3O2Purity:95%Color and Shape: clear liquidMolecular weight:154.09g/mol3-(Trifluoromethyl)dihydrofuran-2(3H)-one
CAS:<p>3-(Trifluoromethyl)dihydrofuran-2(3H)-one is a versatile compound that can be used as an inhibitor or catalyst in various chemical reactions. It has been used in positron emission tomography (PET) studies to investigate the bioavailability and distribution of certain compounds in the body. This compound has also been studied for its interactions with magnesium and aluminum ions, as well as its potential applications as an electrode material. Additionally, 3-(Trifluoromethyl)dihydrofuran-2(3H)-one has shown inhibitory effects on the activity of albendazole, porphyrins, lithocholic acid, and ascorbic acid. It has also exhibited antimicrobial properties against certain alkaloids and fatty acids. Overall, this compound is a valuable tool for researchers in various fields and is commonly used in the study of research chemicals.</p>Formula:C5H5F3O2Purity:Min. 95%Molecular weight:154.09 g/mol


