CAS 17475-67-1
:Hafnium acetylacetonate
Description:
Hafnium acetylacetonate, with the CAS number 17475-67-1, is a coordination compound of hafnium that features the acetylacetonate ligand. This compound typically appears as a yellow to orange solid and is known for its thermal stability and solubility in organic solvents, making it useful in various applications, including as a precursor in chemical vapor deposition (CVD) processes for hafnium oxide thin films. The structure consists of a central hafnium atom coordinated to two acetylacetonate ligands, which are bidentate, meaning they bind through two donor atoms, typically oxygen. This coordination enhances the stability of the complex. Hafnium acetylacetonate is also notable for its potential use in the semiconductor industry due to hafnium's favorable properties for high-k dielectric materials. Additionally, it exhibits interesting optical properties, which can be leveraged in various photonic applications. As with many metal-organic compounds, handling should be done with care, following appropriate safety protocols due to potential toxicity and reactivity.
Formula:C20H28HfO8
InChI:InChI=1S/4C5H7O2.Hf/c4*1-4(6)3-5(2)7;/h4*3H,1-2H3;/q4*-1;+4
InChI key:InChIKey=GXNMJQUZCICHBX-UHFFFAOYSA-N
SMILES:CC1=O[Hf+4]234(O=C(C)[CH-]C(C)=O2)(O=C(C)[CH-]C(C)=O3)(O=C(C)[CH-]C(C)=O4)O=C(C)[CH-]1
Synonyms:- (SA-8-11′′11′′1′1′′′1′1′′′)-Tetrakis(2,4-pentanedionato-κO<sup>2</sup>,κO<sup>4</sup>)hafnium
- 1-[(4-methylphenyl)sulfonyl]-1H-pyrrole
- Hafnium (IV) acetylacetonate
- Hafnium acetylacetonate
- Hafnium tetrakis(acetylacetonate)
- Hafnium, tetrakis(2,4-pentanedionato)-
- Hafnium, tetrakis(2,4-pentanedionato-O,O′)-, (SA-8-11′′11′′1′1′′′1′1′′′)-
- Hafnium, tetrakis(2,4-pentanedionato-κO,κO′)-, (SA-8-11′′11′′1′1′′′1′1′′′)-
- Hafnium, tetrakis(2,4-pentanedionato-κO<sup>2</sup>,κO<sup>4</sup>)-, (SA-8-11′′11′′1′1′′′1′1′′′)-
- Tetrakis(acetylacetonato)hafnium
- hafnium tetrakis[(2Z)-4-oxopent-2-en-2-olate]
- (SA-8-11′′11′′1′1′′′1′1′′′)-Tetrakis(2,4-pentanedionato-κO2,κO4)hafnium
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Hafnium(IV) acetylacetonate, min. 96%
CAS:Hafnium(IV) acetylacetonate, min. 96%
Formula:Hf(CH3COCHCOCH3)4Purity:min. 96%Color and Shape:white to off-white pwdr.Molecular weight:574.93Hafnium acetylacetonate
CAS:Controlled ProductHafnium acetylacetonate is a ferroelectric material, which can be used to remove pollutants from the air. It has been shown that hafnium acetylacetonate can chelate a variety of heavy metals and other pollutants. The metal ions are bound to the nitrogen atoms on the surface of the material, preventing them from reacting with other elements in the environment. Hafnium acetylacetonate has been found to be an efficient catalyst for organic reactions, such as the conversion of carbon monoxide into hydrocarbons. The optimum concentration is determined experimentally, but it is generally between 0.1 and 1%.
Formula:C20H28HfO8Purity:Min. 95%Color and Shape:White/Off-White SolidMolecular weight:574.92 g/molHafnium, tetrakis(2,4-pentanedionato-κO2,κO4)-, (SA-8-11''11''1'1'''1'1''')-
CAS:Formula:C20H28HfO8Purity:97%Color and Shape:SolidMolecular weight:574.9215




