CAS 174775-48-5: 2-Benzofurancarboxylic acid, 5-amino-, ethyl ester
Description:2-Benzofurancarboxylic acid, 5-amino-, ethyl ester, identified by CAS number 174775-48-5, is an organic compound characterized by its benzofuran structure, which consists of a fused benzene and furan ring. This compound features a carboxylic acid functional group and an amino group, contributing to its reactivity and potential biological activity. The ethyl ester moiety enhances its solubility in organic solvents, making it useful in various chemical applications. Typically, compounds of this nature may exhibit properties such as moderate to high polarity, which can influence their interaction with biological systems. The presence of both the amino and carboxylic acid groups suggests potential for hydrogen bonding, which can affect its physical properties, such as melting and boiling points. Additionally, derivatives of benzofuran compounds are often investigated for their pharmacological properties, including anti-inflammatory and antimicrobial activities. Overall, 2-Benzofurancarboxylic acid, 5-amino-, ethyl ester represents a versatile structure in organic synthesis and medicinal chemistry.
Formula:C11H11NO3
InChI:InChI=1S/C11H11NO3/c1-2-14-11(13)10-6-7-5-8(12)3-4-9(7)15-10/h3-6H,2,12H2,1H3
InChI key:InChIKey=YFFLLDHEEWSHQG-UHFFFAOYSA-N
SMILES:O=C(OCC)C=1OC=2C=CC(N)=CC2C1
- Synonyms:
- 2-Benzofurancarboxylic acid, 5-amino-, ethyl ester
- 2-Benzofurancarboxylicacid,5-amino-,ethylester
- 5-Aminobenzofuran-2-carboxylic acid ethyl ester
- 5-Aminobenzofuran-2-carboxylicacid ethyl ester
- Ethyl 5-Amino-1-Benzofuran-2-Carboxylate
- Ethyl 5-aminobenzo[b]furan-2-carboxylate
- Vilazodone Intermediate 5
- Ethyl 5-aminobenzofuran-2-carboxylate
![Ethyl 5-aminobenzo[b]furan-2-carboxylate](https://static.cymitquimica.com/products/54/thumb/OR8508.jpg)
