
CAS 1748-99-8
:α,α-Diphenyl-2-pyridineethanol
Description:
α,α-Diphenyl-2-pyridineethanol, with the CAS number 1748-99-8, is an organic compound characterized by its unique structure, which includes a pyridine ring and two phenyl groups attached to a central carbon bearing a hydroxyl group. This compound typically appears as a solid at room temperature and is known for its potential applications in organic synthesis and as a chiral auxiliary in asymmetric synthesis. It exhibits moderate solubility in organic solvents, such as ethanol and dichloromethane, while being less soluble in water due to its hydrophobic phenyl groups. The presence of the hydroxyl group contributes to its ability to participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Additionally, α,α-Diphenyl-2-pyridineethanol can undergo various chemical transformations, making it a valuable intermediate in the synthesis of more complex organic compounds. Its properties, including melting point and boiling point, can vary based on purity and specific conditions, but it is generally stable under standard laboratory conditions.
Formula:C19H17NO
InChI:InChI=1S/C19H17NO/c21-19(16-9-3-1-4-10-16,17-11-5-2-6-12-17)15-18-13-7-8-14-20-18/h1-14,21H,15H2
InChI key:InChIKey=BVFOXQFXMQQDTN-UHFFFAOYSA-N
SMILES:C(CC1=CC=CC=N1)(O)(C2=CC=CC=C2)C3=CC=CC=C3
Synonyms:- 2-Pyridineethanol, α,α-diphenyl-
- NSC 33783
- α,α-Diphenyl-2-pyridineethanol
- 1,1-Diphenyl-1-hydroxy-2-(2-pyridyl)ethane
- 1,1-Diphenyl-2-(2-pyridyl)ethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
