CAS 17481-06-0
:N-Acetyl-4-fluorophenylalanine
Description:
N-Acetyl-4-fluorophenylalanine is an amino acid derivative characterized by the presence of an acetyl group and a fluorine atom on the phenyl ring. This compound features a phenylalanine backbone, which is an essential amino acid, modified by the addition of an acetyl group at the nitrogen atom and a fluorine atom at the para position of the aromatic ring. The presence of the fluorine atom can influence the compound's biological activity and solubility, potentially enhancing its interaction with biological targets. N-Acetyl-4-fluorophenylalanine is typically used in biochemical research and may serve as a building block in the synthesis of pharmaceuticals or other bioactive compounds. Its properties include being a solid at room temperature, with potential applications in medicinal chemistry due to its structural modifications. As with many fluorinated compounds, it may exhibit unique reactivity and stability characteristics, making it of interest in various chemical and biological studies.
Formula:C11H12FNO3
InChI:InChI=1S/C11H12FNO3/c1-7(14)13-10(11(15)16)6-8-2-4-9(12)5-3-8/h2-5,10H,6H2,1H3,(H,13,14)(H,15,16)
InChI key:InChIKey=NRLBRFQYMSTLJK-UHFFFAOYSA-N
SMILES:C(C(NC(C)=O)C(O)=O)C1=CC=C(F)C=C1
Synonyms:- (2R)-2-(acetylamino)-3-(4-fluorophenyl)propanoate
- (2S)-2-(acetylamino)-3-(4-fluorophenyl)propanoate
- 2-Acetamido-3-(4-fluorophenyl)propanoic acid
- <span class="text-smallcaps">DL</span>-N-Acetyl-4-fluorophenylalanine
- <span class="text-smallcaps">DL</span>-Phenylalanine, N-acetyl-4-fluoro-
- Ac-Phe(4-F)-OH
- Alanine, N-acetyl-3-(p-fluorophenyl)-, <span class="text-smallcaps">DL</span>-
- N-Acetyl-4-fluoro-<span class="text-smallcaps">DL</span>-phenylalanine
- N-Acetyl-<span class="text-smallcaps">DL</span>-(p-fluorophenyl)alanine
- N-Acetyl-<span class="text-smallcaps">DL</span>-4-fluorophenylalanine
- N-Acetyl-p-fluoro-<span class="text-smallcaps">DL</span>-phenylalanine
- N-acetyl-4-fluoro-D-phenylalanine
- N-acetyl-4-fluoro-L-phenylalanine
- N-acetyl-4-fluorophenylalanine
- NSC 523829
- Phenylalanine, N-acetyl-4-fluoro-
- N-Acetyl-DL-(p-fluorophenyl)alanine
- DL-Phenylalanine, N-acetyl-4-fluoro-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Phenylalanine, N-acetyl-4-fluoro-
CAS:Formula:C11H12FNO3Purity:98%Color and Shape:SolidMolecular weight:225.2163N-Acetyl-4-fluoro-DL-phenylalanine
CAS:N-Acetyl-4-fluoro-DL-phenylalaninePurity:97%Molecular weight:225.22g/molN-Acetyl-4-fluoro-dl-phenylalanine
CAS:Formula:C11H12FNO3Purity:98.0%Color and Shape:SolidMolecular weight:225.219N-Acetyl-DL-p-fluorophenylalanine
CAS:N-Acetyl-DL-p-fluorophenylalanine is a chemical compound that can be used as a research chemical, or in the synthesis of other compounds. It is a reactive ingredient and can be used as a reagent. N-Acetyl-DL-p-fluorophenylalanine belongs to the class of speciality chemicals and can be used as an intermediate in the synthesis of other compounds. This compound has been found to be useful for the production of fine chemicals and complex compounds.
Formula:C11H12FNO3Purity:Min. 95%Color and Shape:PowderMolecular weight:225.22 g/mol




