CAS 17481-27-5: 3-Amino-4-methoxybenzamide
Description:3-Amino-4-methoxybenzamide, with the CAS number 17481-27-5, is an organic compound characterized by the presence of an amino group (-NH2) and a methoxy group (-OCH3) attached to a benzene ring. This compound features a benzamide structure, where the amide functional group (-C(=O)NH2) is linked to the aromatic ring. The methoxy group is positioned at the para position relative to the amino group, influencing the compound's reactivity and solubility. 3-Amino-4-methoxybenzamide is typically a white to off-white crystalline solid, and it is soluble in polar solvents such as water and alcohols due to the presence of the amino and carbonyl groups, which can engage in hydrogen bonding. This compound may exhibit biological activity, making it of interest in pharmaceutical research and development. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on purity and environmental conditions. Safety data should be consulted for handling and storage guidelines.
Formula:C8H10N2O2
InChI:InChI=1S/C8H10N2O2/c1-12-7-3-2-5(8(10)11)4-6(7)9/h2-4H,9H2,1H3,(H2,10,11)
InChI key:InChIKey=INCJNDAQNPWMPZ-UHFFFAOYSA-N
SMILES:O=C(N)C1=CC=C(OC)C(N)=C1
- Synonyms:
- (3-Amino-4-methoxybenzoyl)amine
- 3-Amino-4-Methoxy-Benzamide
- 3-Amino-4-anisamide
- 3-Amino-4-methoxybenzenecarboxamide
- 3-Amino-4-methoxybenzoic acid amide
- Benzamide, 3-amino-4-methoxy-
- Db-20
- Fast Red Base KL
- p-Anisamide, 3-amino-
- C.I.Azoic Diazo Component 121
- See more synonyms
- 3-Amino-4-methoxybenzamide