CAS 17481-62-8

2-a)pyrimidine-3-carboxaldehyde,2-chloro-4-oxo-4h-pyrido(

Description:

2-Amino-3-carboxaldehyde, 2-chloro-4-oxo-4H-pyrido is a heterocyclic organic compound characterized by its pyridine and pyrimidine structures. It features a carboxaldehyde functional group, which is known for its reactivity, particularly in condensation reactions. The presence of a chlorine atom introduces additional reactivity and can influence the compound's solubility and stability. The oxo group contributes to the compound's potential as a diketone, which can participate in various chemical reactions, including nucleophilic additions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential applications in synthesizing other complex organic molecules. As with many heterocycles, the compound's properties, such as melting point, boiling point, and solubility, can vary significantly based on the specific substituents and their positions on the ring. Overall, 2-amino-3-carboxaldehyde, 2-chloro-4-oxo-4H-pyrido is a versatile compound with potential applications in various fields of chemistry and pharmacology.

Formula: C₉H₅ClN₂O₂

InChI: InChI=1/C9H5ClN2O2/c10-8-6(5-13)9(14)12-4-2-1-3-7(12)11-8/h1-5H

SMILES: c1ccn2c(c1)nc(c(C=O)c2=O)Cl

Synonyms:

• 2-Chloro-4-Oxo-4H-Pyrido(1,2-A)Pyrimidine-3-Carboxaldehyde
• 2-chloro-4-oxo-4H-pyrido[1,2-a]pyrimidine-3-carbaldehyde

4H-Pyrido[1,2-a]pyrimidine-3-carboxaldehyde, 2-chloro-4-oxo-

CAS: 17481-62-8

Formula: C₉H₅ClN₂O₂

Purity: 97%

Molecular weight: 208.6012

Ref: IN-DA001ZZ2

2-Chloro-4-oxo-4H-pyrido[1,2-a]pyrimidine-3-carbaldehyde

CAS: 17481-62-8

2-Chloro-4-oxo-4H-pyrido[1,2-a]pyrimidine-3-carbaldehyde

Purity: 95%

Molecular weight: 208.6012g/mol

Ref: 54-OR77228

2-chloro-4-oxo-4H-pyrido[1,2-a]pyrimidine-3-carbaldehyde

CAS: 17481-62-8

Formula: C₉H₅ClN₂O₂

Purity: ≥95%

Color and Shape: Liquid

Molecular weight: 208.6

Ref: 10-F367160