CAS 174854-93-4
:1H-indol-4-amine hydrochloride (1:1)
Description:
1H-Indol-4-amine hydrochloride (1:1), with the CAS number 174854-93-4, is a chemical compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. This compound features an amine group at the 4-position of the indole ring, contributing to its basicity and potential reactivity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical research. The compound may exhibit biological activity, making it of interest in medicinal chemistry for the development of therapeutic agents. Its properties include being a solid at room temperature, with potential applications in drug formulation and synthesis. The presence of the amine group allows for further derivatization, which can lead to the exploration of structure-activity relationships in drug design. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper laboratory practices are followed.
Formula:C8H9ClN2
InChI:InChI=1/C8H8N2.ClH/c9-7-2-1-3-8-6(7)4-5-10-8;/h1-5,10H,9H2;1H
SMILES:c1cc(c2cc[nH]c2c1)N.Cl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4-Aminoindole hydrochloride
CAS:Please enquire for more information about 4-Aminoindole hydrochloride including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C8H9ClN2Molecular weight:168.63 g/mol4-Aminoindole hydrochloride
CAS:4-Aminoindole hydrochloride is a white crystalline solid that can be used as a versatile building block in organic synthesis. It is also used as an intermediate in the production of various pharmaceuticals and other chemical compounds. 4-Aminoindole hydrochloride is soluble in most polar solvents, but insoluble in ethers and oils. This compound is also a useful reagent for the conversion of nitrobenzenes to aminobenzoic acids. CAS Number 174854-93-4
Formula:C8H9ClN2Purity:Min. 95%Color and Shape:PowderMolecular weight:168.62 g/mol

