CAS 17488-50-5
:(3-endo)-8-Methyl-8-azabicyclo[3.2.1]oct-3-yl α-hydroxy-α-(hydroxymethyl)benzeneacetate
Description:
(3-endo)-8-Methyl-8-azabicyclo[3.2.1]oct-3-yl α-hydroxy-α-(hydroxymethyl)benzeneacetate, with CAS number 17488-50-5, is a chemical compound characterized by its bicyclic structure, which includes a nitrogen atom in the ring, contributing to its classification as an azabicyclic compound. The presence of the α-hydroxy-α-(hydroxymethyl)benzeneacetate moiety indicates that it possesses both hydroxyl and ester functional groups, which can influence its reactivity and solubility. This compound may exhibit biological activity due to its structural features, potentially interacting with biological targets. Its stereochemistry, particularly the endo configuration, suggests specific spatial arrangements that can affect its pharmacological properties. The compound's unique structure may also lead to interesting applications in medicinal chemistry, particularly in the development of pharmaceuticals. However, detailed studies on its physical and chemical properties, such as solubility, melting point, and stability, would be necessary to fully understand its behavior in various environments.
Formula:C17H23NO4
InChI:InChI=1/C17H23NO4/c1-18-13-7-8-14(18)10-15(9-13)22-16(20)17(21,11-19)12-5-3-2-4-6-12/h2-6,13-15,19,21H,7-11H2,1H3/t13-,14+,15+,17?
InChI key:InChIKey=LNAGCMLWANGVDE-CELGIQRLNA-N
SMILES:C(C(O[C@H]1C[C@@]2(N(C)[C@](C1)(CC2)[H])[H])=O)(CO)(O)C3=CC=CC=C3
Synonyms:- Benzeneacetic acid, α-hydroxy-α-(hydroxymethyl)-, (3-endo)-8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester
- Benzeneacetic acid, α-hydroxy-α-(hydroxymethyl)-, 8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester, endo-(±)-
- (3-endo)-8-Methyl-8-azabicyclo[3.2.1]oct-3-yl α-hydroxy-α-(hydroxymethyl)benzeneacetate
- 1αH,5αH-Tropan-3α-ol, (±)-, 2-phenylglycerate (ester)
- Atropin-7′-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
