CAS 174884-10-7

4-(3-Formylphenoxy)butanoic acid

Description:

4-(3-Formylphenoxy)butanoic acid is an organic compound characterized by its functional groups, which include a carboxylic acid and an aldehyde. This compound features a butanoic acid backbone, which is a four-carbon chain terminating in a carboxylic acid group, and a phenoxy group that is substituted with a formyl group at the para position relative to the ether linkage. The presence of the formyl group contributes to its reactivity, particularly in condensation reactions. The compound is likely to be a white to off-white solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid functionality. Its molecular structure suggests potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. As with many organic compounds, handling should be done with care, considering potential toxicity and reactivity.

Formula: C₁₁H₁₂O₄

InChI: InChI=1S/C11H12O4/c12-8-9-3-1-4-10(7-9)15-6-2-5-11(13)14/h1,3-4,7-8H,2,5-6H2,(H,13,14)

InChI key: InChIKey=QHLKXVXBJDXSHQ-UHFFFAOYSA-N

SMILES: O(CCCC(O)=O)C1=CC(C=O)=CC=C1

Synonyms:

• Butanoic acid, 4-(3-formylphenoxy)-
• 4-(3-Formylphenoxy)butanoic acid

4-(3-Formylphenoxy)butanoic acid

Controlled Product

CAS: 174884-10-7

Versatile small molecule scaffold

Formula: C₁₁H₁₂O₄

Purity: Min. 95%

Molecular weight: 208.21 g/mol

Ref: 3D-ZGA88410