CAS 174899-72-0: 1-ETHYL-2 3-DIMETHYLIMIDAZOLIUM TRIFLUOR
Description:1-Ethyl-2,3-dimethylimidazolium trifluoromethanesulfonate, commonly referred to as an ionic liquid, is characterized by its unique structure and properties. This compound features a cation derived from imidazole, which is a five-membered heterocyclic ring containing nitrogen atoms, and is substituted with ethyl and two methyl groups. The trifluoromethanesulfonate anion contributes to its ionic nature, enhancing its solubility in various solvents and its thermal stability. Ionic liquids like this one are known for their low volatility, making them environmentally friendly alternatives to traditional solvents. They exhibit a wide liquid range, high ionic conductivity, and can be tailored for specific applications in fields such as electrochemistry, catalysis, and materials science. Additionally, the presence of fluorine in the anion can impart unique properties, such as increased hydrophobicity and enhanced thermal stability. Overall, 1-ethyl-2,3-dimethylimidazolium trifluoromethanesulfonate is a versatile compound with significant potential in various chemical processes and applications.
Formula:C8H13F3N2O3S
InChI:InChI=1/C7H13N2.CHF3O3S/c1-4-9-6-5-8(3)7(9)2;2-1(3,4)8(5,6)7/h5-6H,4H2,1-3H3;(H,5,6,7)/q+1;/p-1
- Synonyms:
- 1-ethyl-2,3-dimethyl-1H-imidazol-3-ium trifluoromethanesulfonate
- 1-Ethyl-2,3-Dimethylimidazolium Trifluoromethanesulfonate
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 1H-Imidazolium, 3-ethyl-1,2-dimethyl-, trifluoromethanesulfonate (1:1) REF: IN-DA002019CAS: 174899-72-0 | 99% | 50.00 €~141.00 € | Mon 07 Apr 25 |
![]() | 1-Ethyl-2,3-Dimethylimidazol-3-Ium Trifluoromethanesulfonate REF: 54-PC105093CAS: 174899-72-0 | 99% | 32.00 €~1,793.00 € | Tue 08 Apr 25 |
![]() | 1-Ethyl-2,3-dimethyl-1H-imidazol-3-ium trifluoromethanesulfonate REF: 10-F771270CAS: 174899-72-0 | 98% | - - - | Discontinued product |
![]() | 1-Ethyl-2,3-Dimethyl-1H-Imidazol-3-Ium Trifluoromethanesulfonate REF: 3D-FE97538CAS: 174899-72-0 | Min. 95% | - - - | Discontinued product |

1H-Imidazolium, 3-ethyl-1,2-dimethyl-, trifluoromethanesulfonate (1:1)
Ref: IN-DA002019
1g | 50.00 € | ||
5g | 118.00 € | ||
25g | 141.00 € |

1-Ethyl-2,3-Dimethylimidazol-3-Ium Trifluoromethanesulfonate
Ref: 54-PC105093
1g | 32.00 € | ||
5g | 91.00 € | ||
25g | 116.00 € | ||
100g | 410.00 € | ||
500g | 1,793.00 € |

1-Ethyl-2,3-dimethyl-1H-imidazol-3-ium trifluoromethanesulfonate
Ref: 10-F771270
5g | Discontinued | Request information | |
25g | Discontinued | Request information | |
100g | Discontinued | Request information |

1-Ethyl-2,3-Dimethyl-1H-Imidazol-3-Ium Trifluoromethanesulfonate
Ref: 3D-FE97538
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information |