CymitQuimica logo

CAS 17497-85-7

:

Tribromoisocyanuric acid

Description:
Tribromoisocyanuric acid is a chemical compound that belongs to the class of halogenated isocyanuric acids. It is characterized by its three bromine atoms attached to the isocyanuric acid structure, which enhances its efficacy as a disinfectant and algaecide. This compound is typically found in solid form and is known for its stability and low solubility in water, making it suitable for use in swimming pools and water treatment applications. Its strong oxidizing properties allow it to effectively kill bacteria, viruses, and algae. Additionally, tribromoisocyanuric acid is often utilized in the formulation of various sanitizing agents and is recognized for its ability to release bromine slowly over time, providing prolonged antimicrobial action. Safety considerations include handling it with care, as it can be irritating to the skin and eyes, and proper storage is essential to prevent degradation. Overall, tribromoisocyanuric acid is valued for its effectiveness in maintaining water quality and sanitation in various settings.
Formula:C3Br3N3O3
InChI:InChI=1S/C3Br3N3O3/c4-7-1(10)8(5)3(12)9(6)2(7)11
InChI key:InChIKey=ZKWDCFPLNQTHSH-UHFFFAOYSA-N
SMILES:O=C1N(Br)C(=O)N(Br)C(=O)N1Br
Synonyms:
  • 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3,5-tribromo-
  • s-Triazine-2,4,6(1H,3H,5H)-trione, 1,3,5-tribromo-
  • Tribromocyanuric acid
  • 1,3,5-Tribromo-1,3,5-triazine-2,4,6(1H,3H,5H)-trione
  • s-Triazine-2,4,6(1H,3H,5H)-trione, tribromo-
Found 4 products.