CAS 17498-34-9

2-[(4-hydroxybutoxy)carbonyl]benzoic acid

Description:

2-[(4-Hydroxybutoxy)carbonyl]benzoic acid, with the CAS number 17498-34-9, is an organic compound characterized by its benzoic acid structure modified with a 4-hydroxybutoxycarbonyl group. This compound features a carboxylic acid functional group (-COOH) that contributes to its acidity and potential reactivity. The presence of the hydroxybutoxy group enhances its solubility in polar solvents and may influence its biological activity, making it of interest in pharmaceutical applications. The compound typically exhibits moderate stability under standard conditions but may be sensitive to extreme pH levels or heat. Its molecular structure suggests potential for hydrogen bonding due to the hydroxyl group, which can affect its interactions in biological systems. Additionally, the compound may participate in esterification or other chemical reactions, making it versatile for synthetic applications. Overall, 2-[(4-hydroxybutoxy)carbonyl]benzoic acid is a compound of interest in both organic chemistry and medicinal chemistry due to its functional groups and potential applications.

Formula: C₁₂H₁₄O₅

InChI: InChI=1/C12H14O5/c13-7-3-4-8-17-12(16)10-6-2-1-5-9(10)11(14)15/h1-2,5-6,13H,3-4,7-8H2,(H,14,15)

SMILES: c1ccc(c(c1)C(=O)O)C(=O)OCCCCO

Synonyms:

• 1,2-Benzenedicarboxylic acid, mono(4-hydroxybutyl) ester

1,2-Benzenedicarboxylic acid, 1-(4-hydroxybutyl) ester

CAS: 17498-34-9

Formula: C₁₂H₁₃O₅

Color and Shape: Solid

Molecular weight: 237.2286

Ref: IN-DA00202T

4-Hydroxybutyl-Phthalate

CAS: 17498-34-9

Formula: C₁₂H₁₄O₅

Molecular weight: 238.24

Ref: 4Z-P-368026

1,2-Benzenedicarboxylic acid 1-(4-hydroxybutyl) ester

Controlled Product

CAS: 17498-34-9

Benzoic acid 1-(4-hydroxybutyl) ester is a metabolite of benzenedicarboxylic acid, which is the active ingredient in some insecticides. Benzoic acid 1-(4-hydroxybutyl) ester is found in amniotic fluid and maternal urine. It is a toxicant to the fetus and can cause severe neurological damage if ingested by a pregnant woman. The toxicological effects are due to its ability to inhibit the synthesis of proteins necessary for cell division and growth, as well as its ability to induce oxidative stress.

Formula: C₁₂H₁₄O₅

Purity: Min. 95%

Molecular weight: 238.24 g/mol

Ref: 3D-FB18183