CymitQuimica logo

CAS 175021-11-1

:

(3,3-dimethoxycyclobutyl)methanol

Description:
(3,3-Dimethoxycyclobutyl)methanol is an organic compound characterized by its cyclobutane ring structure, which is substituted with two methoxy groups and a hydroxymethyl group. The presence of the methoxy groups contributes to its potential as a polar compound, influencing its solubility and reactivity. The hydroxymethyl group introduces a functional alcohol group, which can participate in hydrogen bonding, enhancing its interactions with other polar substances. This compound may exhibit interesting chemical properties, such as the ability to undergo various reactions typical of alcohols, including oxidation and esterification. Additionally, the unique cyclobutane framework may impart strain, affecting its stability and reactivity. The compound's molecular structure suggests potential applications in organic synthesis, pharmaceuticals, or as a building block in the development of more complex molecules. However, specific physical properties such as boiling point, melting point, and solubility would require empirical data for precise characterization. Overall, (3,3-dimethoxycyclobutyl)methanol represents a versatile structure within organic chemistry, with potential implications in various chemical applications.
Formula:C7H14O3
InChI:InChI=1/C7H14O3/c1-9-7(10-2)3-6(4-7)5-8/h6,8H,3-5H2,1-2H3
InChI key:PPZLOPBUFOFNKE-UHFFFAOYSA-N
SMILES:COC1(CC(C1)CO)OC
Synonyms:
  • Cyclobutanemethanol, 3,3-Dimethoxy-
  • (3,3-Dimethoxycyclobutyl)methanol
  • 3,3-Dimethoxycyclobutanemethanol
Found 4 products.