CAS 17509-54-5
:2-(4-methoxyphenoxy)-2-methylpropanoic acid
Description:
2-(4-Methoxyphenoxy)-2-methylpropanoic acid, with the CAS number 17509-54-5, is an organic compound characterized by its unique structure, which includes a methoxy group and a phenoxy moiety attached to a branched propanoic acid backbone. This compound typically exhibits properties associated with carboxylic acids, such as the ability to form hydrogen bonds, which can influence its solubility in polar solvents. The presence of the methoxy group enhances its lipophilicity, potentially affecting its biological activity and interaction with various biological systems. It may also exhibit moderate to high stability under standard conditions, although specific stability can depend on environmental factors such as pH and temperature. In terms of applications, compounds of this nature are often investigated for their potential roles in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The precise characteristics, including melting point, boiling point, and solubility, would require empirical data for accurate determination, but they are generally influenced by the functional groups present in the molecule.
Formula:C11H14O4
InChI:InChI=1/C11H14O4/c1-11(2,10(12)13)15-9-6-4-8(14-3)5-7-9/h4-7H,1-3H3,(H,12,13)
SMILES:CC(C)(C(=O)O)Oc1ccc(cc1)OC
Synonyms:- Propanoic Acid, 2-(4-Methoxyphenoxy)-2-Methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-(4-Methoxyphenoxy)-2-methylpropanoic acid
CAS:2-(4-Methoxyphenoxy)-2-methylpropanoic acid (methoxymethyl) is a versatile building block with a variety of applications in synthesis. It is used as an intermediate in the preparation of pharmaceuticals, agrochemicals, and dyes. Methoxymethyl has been shown to be useful as a reagent for research and as a speciality chemical. This compound can also serve as a reaction component or scaffold in the synthesis of more complex compounds.Formula:C11H14O4Purity:Min. 95%Color and Shape:PowderMolecular weight:210.23 g/mol2-(4-Methoxy-phenoxy)-2-methyl-propionic acid
CAS:Formula:C11H14O4Purity:95.0%Molecular weight:210.229


