CAS 1751-97-9

BIPHENYL-3,3'-DICARBOXYLIC ACID DIMETHYL ESTER

Description:

Biphenyl-3,3'-dicarboxylic acid dimethyl ester, with the CAS number 1751-97-9, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features two carboxylic acid groups that are esterified with methanol, resulting in dimethyl ester functional groups. It is typically a white to off-white crystalline solid, exhibiting moderate solubility in organic solvents such as ethanol and acetone, while being less soluble in water. The presence of the ester groups contributes to its chemical reactivity, making it useful in various chemical syntheses and applications, including as an intermediate in the production of pharmaceuticals and agrochemicals. Additionally, biphenyl derivatives are known for their potential applications in materials science, particularly in the development of polymers and liquid crystals. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.

Formula: C₁₆H₁₄O₄

InChI: InChI=1/C16H14O4/c1-19-15(17)13-7-3-5-11(9-13)12-6-4-8-14(10-12)16(18)20-2/h3-10H,1-2H3

SMILES: COC(=O)c1cccc(c1)c1cccc(c1)C(=O)OC

Synonyms:

• [1,1'-Biphenyl]-3,3'-Dicarboxylic Acid, Dimethyl Ester
• Dimethyl biphenyl-3,3'-dicarboxylate

Biphenyl-3,3'-dicarboxylic acid dimethyl ester

CAS: 1751-97-9

Formula: C₁₆H₁₄O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 270.2800

Ref: IN-DA002050

Dimethyl [1,1'-biphenyl]-3,3'-dicarboxylate

CAS: 1751-97-9

Dimethyl [1,1'-biphenyl]-3,3'-dicarboxylate

Purity: 98%

Molecular weight: 270.28g/mol

Ref: 54-OR70209

DIMETHYL BIPHENYL-3,3′-DICARBOXYLATE

CAS: 1751-97-9

Formula: C₁₆H₁₄O₄

Purity: 98%

Molecular weight: 270.284

Ref: 10-F472309

Methyl 3-[3-(methoxycarbonyl)phenyl]benzoate

CAS: 1751-97-9

Versatile small molecule scaffold

Formula: C₁₆H₁₄O₄

Purity: Min. 95%

Molecular weight: 270.28 g/mol

Ref: 3D-BAA75197