CAS 17510-99-5
:2-keto-3-Deoxygluconate
Description:
2-Keto-3-deoxygluconate, also known as KDG, is a keto sugar derivative of gluconic acid. It is characterized by the presence of a ketone functional group at the second carbon and a deoxy group at the third carbon, which distinguishes it from its parent compound, gluconate. This compound typically appears as a white to off-white solid and is soluble in water, making it useful in various biochemical applications. KDG plays a significant role in metabolic pathways, particularly in the degradation of sugars and as an intermediate in the Entner-Doudoroff pathway, which is an alternative to glycolysis. Its structure allows it to participate in various enzymatic reactions, and it can be involved in the synthesis of other biochemical compounds. Additionally, KDG has been studied for its potential applications in food science and biotechnology, particularly in fermentation processes. As with many biochemical substances, its stability and reactivity can be influenced by environmental conditions such as pH and temperature.
Formula:C6H10O6
InChI:InChI=1/C6H10O6/c7-2-5(10)3(8)1-4(9)6(11)12/h3,5,7-8,10H,1-2H2,(H,11,12)/t3-,5+/m0/s1
InChI key:InChIKey=WPAMZTWLKIDIOP-WVZVXSGGSA-N
SMILES:[C@H](CC(C(O)=O)=O)([C@@H](CO)O)O
Synonyms:- 2-Dehydro-3-deoxy-<span class="text-smallcaps">D</span>-gluconic acid
- 2-Keto-3-Deoxy-<span class="text-smallcaps">D</span>-gluconic acid
- 2-Keto-3-Deoxygluconate
- 2-Keto-3-deoxy-D-gluconic acid
- 2-Oxo-3-deoxy-<span class="text-smallcaps">D</span>-gluconate
- 2-keto-3-Deoxy-<span class="text-smallcaps">D</span>-gluconate
- 2-keto-3-Deoxygluconic acid
- 3-Deoxy-2-oxo-<span class="text-smallcaps">D</span>-gluconate
- 3-Deoxy-<span class="text-smallcaps">D</span>-erythro-2-hexulosonic acid
- 3-Deoxy-<span class="text-smallcaps">D</span>-erythro-hex-2-ulosonic acid
- 3-Deoxyhex-2-Ulosonic Acid
- 3-deoxy-D-erythro-hex-2-ulosonic acid
- <span class="text-smallcaps">D</span>-erythro-2-Hexulosonic acid, 3-deoxy-
- <span class="text-smallcaps">D</span>-erythro-Hexulosonic acid, 3-deoxy-
- D-erythro-Hexulosonic acid, 3-deoxy-
- 2-keto-3-Deoxy-D-gluconate
- 3-Deoxy-D-erythro-2-hexulosonic acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-Keto-3-Deoxy-D-Gluconic Acid (Mixture of Tautomeric Isomers)
CAS:Formula:C6H10O6Molecular weight:178.143-Deoxy-2-keto-D-gluconate lithium
CAS:<p>3-Deoxy-2-keto-D-gluconate lithium salt (3DG) is a molecule that is structurally similar to glucose. It has been shown to be an ATP-binding cassette transporter inhibitor, which prevents the transport of glucose by the glomerular filtration rate. 3DG is also an inhibitor of xylulose 5-phosphate reductase and fructose 1,6-bisphosphatase, leading to decreased synthesis of glycogen. 3DG can also inhibit gluconeogenesis in the liver by inhibiting phosphoenolpyruvate carboxykinase and pyruvate carboxylase activity. This molecule is chemically stable, meaning it will not break down into toxic substances when exposed to air or water. The enzyme activities of 3DG are being tested for their potential therapeutic effects in diabetes mellitus type 2 patients.</p>Formula:C6H10O6•LixPurity:Min. 95%Color and Shape:White PowderMolecular weight:178.14 g/mol

