CAS 17511-89-6
:1-Phenylcyclopentanemethanamine
Description:
1-Phenylcyclopentanemethanamine, identified by its CAS number 17511-89-6, is an organic compound characterized by its unique structure, which includes a cyclopentane ring substituted with a phenyl group and an amine functional group. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the phenyl group contributes to its aromatic characteristics, potentially affecting its reactivity and interaction with other chemical species. In terms of physical properties, it may have moderate volatility and a specific boiling point, although these can vary based on purity and environmental conditions. The compound's applications may span fields such as pharmaceuticals, where it could serve as an intermediate or a building block for more complex molecules. Safety considerations should be taken into account, as with many amines, due to potential toxicity and reactivity. Overall, 1-Phenylcyclopentanemethanamine is a compound of interest in organic synthesis and medicinal chemistry.
Formula:C12H17N
InChI:InChI=1/C12H17N/c13-10-12(8-4-5-9-12)11-6-2-1-3-7-11/h1-3,6-7H,4-5,8-10,13H2
InChI key:InChIKey=SJWOFBVBNFLWLP-UHFFFAOYSA-N
SMILES:C(N)C1(CCCC1)C2=CC=CC=C2
Synonyms:- (1-Phenylcyclopentyl)methanamine
- (1-Phenylcyclopentyl)methaneamine
- 1-(1-Phenylcyclopentyl)Methanamine
- 1-Aminomethyl-1-phenylcyclopentane
- 1-Phenylcyclopentanemethanamine
- 1-Phenylcyclopentanemethylamine
- Brn 2936636
- Cyclopentanemethanamine, 1-phenyl-
- Cyclopentanemethylamine, 1-phenyl-
- 4-12-00-02971 (Beilstein Handbook Reference)
- (1-phenylcyclopentyl)methanamine hydrochloride
- 1-(1-phenylcyclopentyl)methanamine(SALTDATA: FREE)
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Cyclopentanemethanamine, 1-phenyl-
CAS:Formula:C12H17NPurity:97%Color and Shape:SolidMolecular weight:175.2701(1-Phenylcyclopentyl)methylamine
CAS:(1-Phenylcyclopentyl)methylaminePurity:95%Molecular weight:175.27g/mol1-(1-phenylcyclopentyl)methanamine
CAS:Formula:C12H17NPurity:97%Color and Shape:SolidMolecular weight:175.275C-(1-Phenyl-cyclopentyl)-methylamine hydrochloride
CAS:C-(1-Phenyl-cyclopentyl)-methylamine hydrochloride is a versatile compound that has various applications in different industries. It is commonly used as a racemase inhibitor and can be found in medications such as tiagabine hydrochloride, which is used to treat epilepsy. This compound also acts as a glycoprotein stabilizer and plasticizer, making it useful in the production of pharmaceuticals and plastics. Additionally, C-(1-Phenyl-cyclopentyl)-methylamine hydrochloride is used in the synthesis of other chemicals like l-lysine, metformin hydrochloride, and hydroxybenzoic acid. Its unique properties also make it suitable for research purposes, including the development of microcapsules and electrodes. With its diverse range of applications, this compound plays a crucial role in various industries.Formula:C12H18ClNPurity:Min. 95%Molecular weight:211.74 g/mol



