CAS 17513-09-6

N'-CYANOBENZENECARBOXIMIDAMIDE

Description:

N'-Cyanobenzenecarboximidamide, with the CAS number 17513-09-6, is a chemical compound characterized by its unique functional groups, including a cyanide group and an imidamide structure. This compound typically appears as a solid and is known for its potential applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. The presence of the cyanide group imparts certain reactivity, making it useful in nucleophilic substitution reactions. Additionally, the imidamide moiety can participate in hydrogen bonding, influencing its solubility and interaction with other molecules. The compound's stability and reactivity can vary depending on environmental conditions such as pH and temperature. Safety considerations are important when handling this substance due to the toxicity associated with cyanide derivatives. Overall, N'-Cyanobenzenecarboximidamide is a valuable compound in the field of synthetic chemistry, contributing to the development of more complex chemical entities.

Formula: C₈H₇N₃

InChI: InChI=1/C8H7N3/c9-6-11-8(10)7-4-2-1-3-5-7/h1-5H,(H2,10,11)

SMILES: c1ccc(cc1)C(=N)NC#N

Synonyms:

• benzenecarboximidamide, N-cyano-
• N-Cyanobenzenecarboximidamide

N-Cyanobenzenecarboximidamide

CAS: 17513-09-6

Formula: C₈H₇N₃

Molecular weight: 145.1613

Ref: IN-DA00205E

N'-Cyanobenzenecarboximidamide

CAS: 17513-09-6

N'-Cyanobenzenecarboximidamide

Purity: 90%

Molecular weight: 145.16g/mol

Ref: 54-OR1002946

N'-Cyanobenzenecarboximidamide hydrochloride

CAS: 17513-09-6

N-Cyanobenzenecarboximidamide hydrochloride (NCBCH) is an intermediate for the synthesis of azomethine dyes. It can be used to produce azo dyes with a methoxy group at the 3 position and a hydrogen atom at the 4 position. NCBCH is also an excellent substrate for chemical reactions involving fragmentation, extraction, or elimination. NCBCH can be synthesized from methyl ether and benzonitrile in the presence of benzamidine. The product is then treated with methanol to give a tautomeric mixture of benzyl and methyl ether.

Formula: C₈H₇N₃

Purity: Min. 95%

Molecular weight: 145.16 g/mol

Ref: 3D-FC122839