CAS 175135-25-8
:2-(ALLYLTHIO)NICOTINIC ACID
Description:
2-(Allylthio)nicotinic acid is a chemical compound characterized by its unique structure, which includes a nicotinic acid moiety substituted with an allylthio group. This compound features a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom, and a carboxylic acid functional group that contributes to its acidity. The presence of the allylthio group introduces a sulfur atom into the structure, which can influence the compound's reactivity and potential biological activity. This compound may exhibit properties such as antimicrobial or anti-inflammatory effects, making it of interest in medicinal chemistry. Additionally, its solubility and stability can vary depending on the pH and solvent conditions. As with many nicotinic acid derivatives, it may also interact with biological systems through mechanisms involving nicotinic receptors. Overall, 2-(allylthio)nicotinic acid represents a fascinating area of study within organic and medicinal chemistry, with potential applications in drug development and therapeutic research.
Formula:C9H9NO2S
InChI:InChI=1/C9H9NO2S/c1-2-6-13-8-7(9(11)12)4-3-5-10-8/h2-5H,1,6H2,(H,11,12)
SMILES:C=CCSc1c(cccn1)C(=O)O
Synonyms:- Labotest-Bb Lt00453657
- 2-(Allylmercapto)nicotinicacid
- 2-(Allylthio)pyridine-3-carboxylicacid
- 2-(Prop-2-En-1-Ylsulfanyl)Pyridine-3-Carboxylic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-(Allylthio)nicotinic acid, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C9H9NO2SPurity:98%Color and Shape:White to cream to pale yellow, Crystals or powder or crystalline powder or fused solid or needlesMolecular weight:195.243-PYRIDINECARBOXYLIC ACID, 2-(2-PROPEN-1-YLTHIO)-
CAS:Formula:C9H9NO2SPurity:95%Color and Shape:SolidMolecular weight:195.2383



