CAS 175135-32-7

2-Amino-4-(3,4-difluorophenyl)thiazole

Description:

2-Amino-4-(3,4-difluorophenyl)thiazole is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. This compound features an amino group (-NH2) and a difluorophenyl substituent, indicating the presence of two fluorine atoms on the phenyl ring. The thiazole moiety contributes to its potential biological activity, making it of interest in medicinal chemistry. The presence of fluorine atoms can enhance the lipophilicity and metabolic stability of the compound, which may influence its pharmacokinetic properties. Typically, compounds like this may exhibit various biological activities, including antimicrobial or anticancer properties, although specific activities would depend on further empirical studies. Its molecular structure allows for potential interactions with biological targets, making it a candidate for drug development. As with many thiazole derivatives, it may also be involved in various chemical reactions, including nucleophilic substitutions and coupling reactions, which are relevant in synthetic organic chemistry.

Formula: C₁₅H₁₁ClFNO

InChI: InChI=1/C15H11ClFNO/c16-14-2-1-3-15(17)13(14)10-19-12-6-4-11(5-7-12)8-9-18/h1-7H,8,10H2

SMILES: c1cc(c(COc2ccc(cc2)CC#N)c(c1)F)Cl

2-Thiazolamine, 4-(3,4-difluorophenyl)-

CAS: 175135-32-7

Formula: C₉H₆F₂N₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 212.2191

Ref: IN-DA00206W

2-Amino-4-(3,4-difluorophenyl)-1,3-thiazole

CAS: 175135-32-7

2-Amino-4-(3,4-difluorophenyl)-1,3-thiazole

Formula: C₉H₆F₂N₂S

Purity: 98%

Color and Shape: off white to light orange crystals

Molecular weight: 212.22g/mol

Ref: 54-PC1070T

2-Amino-4-(3,4-difluorophenyl)thiazole

CAS: 175135-32-7

Formula: C₉H₆F₂N₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 212.22

Ref: 10-F008188

4-(3,4-Difluorophenyl)-2-Thiazolamine

CAS: 175135-32-7

4-(3,4-Difluorophenyl)-2-Thiazolamine is a compound that inhibits the activity of enzymes such as hydroxylase, esterases and lipases. It also has hypoxia-inducible activity, which means that it can be used as a potential therapeutic agent for conditions such as cancer or diabetes. 4-(3,4-Difluorophenyl)-2-Thiazolamine has been shown to have an IC50 value of 0.183 μM in cells infected with HIV-1. This compound is able to inhibit the human enzyme HIF-1α and upregulate the expression of genes involved in the production of erythropoietin.

Formula: C₉H₆F₂N₂S

Purity: Min. 95%

Molecular weight: 212.22 g/mol

Ref: 3D-FD83673