CAS 175135-46-3: 4,5-Dichloro-2-(2-fluorobenzyl)pyridazine-3(2H)-one

Description:4,5-Dichloro-2-(2-fluorobenzyl)pyridazine-3(2H)-one is a chemical compound characterized by its pyridazine core, which is a six-membered aromatic ring containing two nitrogen atoms. The presence of dichloro substituents at the 4 and 5 positions enhances its reactivity and potential biological activity. The 2-(2-fluorobenzyl) group introduces a fluorobenzyl moiety, which can influence the compound's lipophilicity and interaction with biological targets. This compound is likely to exhibit properties typical of halogenated organic compounds, such as increased stability and potential for diverse chemical reactivity. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both halogen atoms and a heterocyclic framework. Additionally, the compound's unique combination of functional groups may contribute to its specificity in biological interactions, making it a candidate for further research in drug discovery and development. As with many such compounds, safety and handling precautions should be observed due to the presence of halogens and the potential for biological activity.

Formula:C₁₁H₇Cl₂FN₂O

InChI:InChI=1/C11H7Cl2FN2O/c12-8-5-15-16(11(17)10(8)13)6-7-3-1-2-4-9(7)14/h1-5H,6H2

Synonyms:
4,5-dichloro-2-(2-fluorobenzyl)pyridazin-3(2H)-one

Found 4 products.

Product data	Purity	Price range	Estimated delivery
4,5-Dichloro-2-(2-fluorobenzyl)pyridazine-3(2H)-one REF: 10-F008278CAS: 175135-46-3	- - -	179.00 €	Tue 15 Apr 25
3(2H)-Pyridazinone, 4,5-dichloro-2-[(2-fluorophenyl)methyl]- REF: IN-DA00206ICAS: 175135-46-3	- - -	To inquire	Thu 17 Apr 25
4,5-Dichloro-2-(2-fluorobenzyl)pyridazine-3(2H)-one REF: 54-PC2404CAS: 175135-46-3	97%	56.00 €	Mon 21 Apr 25
4,5-Dichloro-2-(2-Fluorobenzyl)-3(2H)-Pyridazinone REF: 3D-FD92089CAS: 175135-46-3	Min. 95%	145.00 €~504.00 €	Thu 29 May 25