CymitQuimica logo

CAS 175135-64-5

:

3-amino-2-(4-fluorophenoxy)pyridine

Description:
3-Amino-2-(4-fluorophenoxy)pyridine is an organic compound characterized by its pyridine ring, which is substituted at the 2-position with a 4-fluorophenoxy group and at the 3-position with an amino group. This structure imparts unique chemical properties, including potential for hydrogen bonding due to the amino group and the ability to participate in aromatic interactions due to the fluorophenoxy moiety. The presence of the fluorine atom enhances the compound's lipophilicity and may influence its biological activity. This compound is typically used in medicinal chemistry and drug development, where it may serve as a scaffold for synthesizing biologically active molecules. Its solubility and reactivity can vary based on the functional groups present, making it a versatile intermediate in organic synthesis. Additionally, the compound's specific interactions with biological targets can be explored through structure-activity relationship studies, contributing to the development of pharmaceuticals. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C11H9FN2O
InChI:InChI=1/C11H9FN2O/c12-8-4-1-2-6-10(8)15-11-9(13)5-3-7-14-11/h1-7H,13H2
InChI key:GMDOUPKGOUGJHO-UHFFFAOYSA-N
SMILES:c1ccc(c(c1)F)Oc1c(cccn1)N
Synonyms:
  • 2-(2-Fluorophenoxy)Pyridin-3-Amine
Found 3 products.