CAS 175135-93-0

2-bromo-1-(3-chloro-4-methylphenyl)propan-1-one

Description:

2-bromo-1-(3-chloro-4-methylphenyl)propan-1-one is an organic compound characterized by its structural features, which include a bromine atom and a chloro-substituted aromatic ring. This compound belongs to the class of ketones, specifically featuring a propanone backbone. The presence of the bromine and chlorine substituents contributes to its reactivity and potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The compound's molecular structure suggests it may exhibit interesting physical properties, such as solubility in organic solvents and varying melting and boiling points depending on the specific conditions. Additionally, the presence of halogens can influence its biological activity, making it a subject of interest in medicinal chemistry. Safety considerations are essential when handling this compound, as halogenated organic compounds can pose health risks. Overall, 2-bromo-1-(3-chloro-4-methylphenyl)propan-1-one is a notable compound in the field of synthetic organic chemistry, with potential applications driven by its unique chemical properties.

Formula: C₁₀H₁₀BrClO

InChI: InChI=1/C10H10BrClO/c1-6-3-4-8(5-9(6)12)10(13)7(2)11/h3-5,7H,1-2H3

SMILES: Cc1ccc(cc1Cl)C(=O)C(C)Br

2-Bromo-3'-chloro-4'-methylpropiophenone

CAS: 175135-93-0

2-Bromo-3'-chloro-4'-methylpropiophenone

Formula: C₁₀H₁₀BrClO

Purity: 90%

Color and Shape: brown low melting solid

Molecular weight: 261.54g/mol

Ref: 54-OR21756