CAS 175135-96-3

ethyl 3-(2-chloro-3,4-dimethoxyphenyl)acrylate

Description:

Ethyl 3-(2-chloro-3,4-dimethoxyphenyl)acrylate is an organic compound characterized by its ester functional group, which is derived from the reaction of acrylic acid and an alcohol, in this case, ethyl alcohol. The compound features a chloro-substituted aromatic ring, specifically a phenyl group with two methoxy groups at the 3 and 4 positions, contributing to its chemical reactivity and potential biological activity. The presence of the chloro group enhances the compound's electrophilicity, making it useful in various synthetic applications. Ethyl 3-(2-chloro-3,4-dimethoxyphenyl)acrylate is typically a colorless to pale yellow liquid, exhibiting moderate solubility in organic solvents. Its structure suggests potential applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. As with many chemical substances, handling should be done with care, considering safety data and potential hazards associated with its use.

Formula: C₁₃H₁₅ClO₄

InChI: InChI=1/C13H15ClO4/c1-4-18-11(15)8-6-9-5-7-10(16-2)13(17-3)12(9)14/h5-8H,4H2,1-3H3/b8-6+

Synonyms:

• ethyl (2E)-3-(2-chloro-3,4-dimethoxyphenyl)prop-2-enoate

Ethyl 3-(2-chloro-3,4-dimethoxyphenyl)acrylate

CAS: 175135-96-3

Ethyl 3-(2-chloro-3,4-dimethoxyphenyl)acrylate

Purity: ≥95%

Molecular weight: 270.71g/mol

Ref: 54-OR21780