CymitQuimica logo

CAS 175137-03-8

:

methyl 3-amino-5-(tert-butyl)thiophene-2-carboxylate

Description:
Methyl 3-amino-5-(tert-butyl)thiophene-2-carboxylate is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. This compound features an amino group and a tert-butyl substituent, which contribute to its unique chemical properties. The presence of the carboxylate group indicates that it can participate in various chemical reactions, such as esterification or amidation. The tert-butyl group enhances the steric bulk around the thiophene ring, potentially influencing its reactivity and solubility. This compound may exhibit interesting biological activities, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for potential interactions with biological targets, and it may serve as a building block for synthesizing more complex molecules. Additionally, the compound's stability and solubility in organic solvents can facilitate its use in various synthetic applications. Overall, methyl 3-amino-5-(tert-butyl)thiophene-2-carboxylate is a versatile compound with potential applications in both research and industry.
Formula:C10H15NO2S
InChI:InChI=1/C10H15NO2S/c1-10(2,3)7-5-6(11)8(14-7)9(12)13-4/h5H,11H2,1-4H3
InChI key:WHJBGOQJMFAKHY-UHFFFAOYSA-N
SMILES:CC(C)(C)c1cc(c(C(=O)OC)s1)N
Synonyms:
  • Methyl 3-amino-5-[4-(tert-butyl)thiophene-2-carboxylate
Found 4 products.