CymitQuimica logo

CAS 175137-06-1

:

1-[3-amino-5-(tert-butyl)-2-thienyl]ethan-1-one

Description:
1-[3-amino-5-(tert-butyl)-2-thienyl]ethan-1-one, with the CAS number 175137-06-1, is an organic compound characterized by its thienyl structure, which incorporates a thiophene ring. This compound features an amino group and a tert-butyl substituent, contributing to its unique chemical properties. The presence of the ethanone functional group indicates that it is a ketone, which typically exhibits reactivity associated with carbonyl compounds, such as nucleophilic addition. The thienyl ring can participate in various chemical reactions, including electrophilic substitution, due to its aromatic nature. Additionally, the tert-butyl group enhances the steric bulk around the molecule, potentially influencing its reactivity and solubility. This compound may be of interest in medicinal chemistry and materials science due to its structural features, which could impart specific biological activities or physical properties. Overall, its characteristics make it a subject of interest for further research and application in various chemical contexts.
Formula:C10H15NOS
InChI:InChI=1/C10H15NOS/c1-6(12)9-7(11)5-8(13-9)10(2,3)4/h5H,11H2,1-4H3
SMILES:CC(=O)c1c(cc(C(C)(C)C)s1)N
Synonyms:
  • 2-Acetyl-3-amino-5-t-butylthiophene
  • 1-(3-Amino-5-Tert-Butylthiophen-2-Yl)Ethanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.