CAS 175137-43-6

Methyl 5-(4-morpholinyl)-2H-tetrazole-2-acetate

Description:

Methyl 5-(4-morpholinyl)-2H-tetrazole-2-acetate is a chemical compound characterized by its tetrazole ring, which is a five-membered heterocyclic structure containing four nitrogen atoms and one carbon atom. This compound features a morpholine group, which is a six-membered ring containing both oxygen and nitrogen, contributing to its potential biological activity. The acetate moiety indicates the presence of an ester functional group, which can influence the compound's solubility and reactivity. Methyl 5-(4-morpholinyl)-2H-tetrazole-2-acetate is often studied for its pharmacological properties, particularly in the context of medicinal chemistry, where tetrazole derivatives are known for their diverse biological activities, including anti-inflammatory and antimicrobial effects. The compound's molecular structure allows for various interactions with biological targets, making it a subject of interest in drug development. Its specific physical and chemical properties, such as melting point, solubility, and stability, would typically be determined through experimental methods and may vary based on environmental conditions.

Formula: C₈H₁₃N₅O₃

InChI: InChI=1S/C8H13N5O3/c1-15-7(14)6-13-10-8(9-11-13)12-2-4-16-5-3-12/h2-6H2,1H3

InChI key: InChIKey=IZIVVKVBLMTIFD-UHFFFAOYSA-N

SMILES: C(C(OC)=O)N1N=C(N=N1)N2CCOCC2

Synonyms:

• 2H-Tetrazole-2-acetic acid, 5-(4-morpholinyl)-, methyl ester
• Methyl 5-(4-morpholinyl)-2H-tetrazole-2-acetate
• methyl (5-morpholin-4-yl-2H-tetrazol-2-yl)acetate

2H-Tetrazole-2-acetic acid, 5-(4-morpholinyl)-, methyl ester

CAS: 175137-43-6

Formula: C₈H₁₃N₅O₃

Molecular weight: 227.2205

Ref: IN-DA0020BS

Methyl [5-(4-morpholino)tetrazol-2-yl]acetate

CAS: 175137-43-6

Methyl [5-(4-morpholino)tetrazol-2-yl]acetate

Purity: ≥95%

Molecular weight: 227.22g/mol

Ref: 54-OR9744