CymitQuimica logo

CAS 175137-54-9

:

ethyl 2-(4-bromo-3,5-dimethyl-1H-pyrazol-1-yl)acetate

Description:
Ethyl 2-(4-bromo-3,5-dimethyl-1H-pyrazol-1-yl)acetate is an organic compound characterized by its pyrazole ring structure, which contributes to its biological activity and potential applications in medicinal chemistry. The presence of the bromo substituent enhances its reactivity and can influence its pharmacological properties. This compound features an ethyl acetate moiety, which is known for its ester functional group, providing it with distinct solubility characteristics and reactivity patterns typical of esters. The dimethyl groups on the pyrazole ring can affect steric hindrance and electronic properties, potentially impacting its interaction with biological targets. Ethyl 2-(4-bromo-3,5-dimethyl-1H-pyrazol-1-yl)acetate may exhibit various properties such as moderate volatility and solubility in organic solvents, making it suitable for synthesis and formulation in chemical research. Its CAS number, 175137-54-9, allows for easy identification and reference in chemical databases. Overall, this compound is of interest for its potential applications in pharmaceuticals and agrochemicals.
Formula:C9H13BrN2O2
InChI:InChI=1/C9H13BrN2O2/c1-4-14-8(13)5-12-7(3)9(10)6(2)11-12/h4-5H2,1-3H3
InChI key:YWDSLMPDMFFYNV-UHFFFAOYSA-N
SMILES:CCOC(=O)Cn1c(C)c(c(C)n1)Br
Synonyms:
  • ethyl (4-bromo-3,5-dimethyl-1H-pyrazol-1-yl)acetate
Found 3 products.